| CNU23_00003076-RA | CNU23_00003076 | maker-COCO01-augustus-gene-0.119-mRNA-1 | XP_010927120 | uncharacterized LOC105049239(LOC105049239) | Elaeis guineensis | - | - | - | - | IPR008979:Galactose-binding domain-like;IPR013857:NADH:ubiquinone oxidoreductase intermediate-associated protein 30;IPR016040:NAD(P)-binding domain; |
| CNU23_00003077-RA | CNU23_00003077 | maker-COCO01-augustus-gene-0.120-mRNA-1 | XP_010927120 | uncharacterized LOC105049239(LOC105049239) | Elaeis guineensis | - | - | - | - | IPR008979:Galactose-binding domain-like;IPR013857:NADH:ubiquinone oxidoreductase intermediate-associated protein 30;IPR016040:NAD(P)-binding domain; |
| CNU23_00003078-RA | CNU23_00003078 | maker-COCO01-augustus-gene-1.25-mRNA-1 | XP_010927122 | leucine-rich repeat extensin-like protein 2(LOC105049242) | Elaeis guineensis | - | - | - | - | IPR001611:Leucine-rich repeat;IPR003591:Leucine-rich repeat; typical subtype; |
| CNU23_00003079-RA | CNU23_00003079 | maker-COCO01-augustus-gene-1.119-mRNA-1 | XP_010927126 | zinc finger CCCH domain-containing protein 46(LOC105049246) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | egu03013:Nucleocytoplasmic transport; | IPR000571:Zinc finger; CCCH-type; |
| CNU23_00003080-RA | CNU23_00003080 | maker-COCO01-augustus-gene-1.118-mRNA-1 | XP_010927124 | LOW QUALITY PROTEIN: uncharacterized protein LOC105049245 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003081-RA | CNU23_00003081 | genemark-COCO01-processed-gene-1.80-mRNA-1 | XP_019707372 | uncharacterized LOC105049243(LOC105049243) | Elaeis guineensis | - | - | - | - | IPR006869:Domain of unknown function DUF547;IPR025757:Ternary complex factor MIP1; leucine-zipper; |
| CNU23_00003082-RA | CNU23_00003082 | maker-COCO01-augustus-gene-2.14-mRNA-1 | XP_010927122 | leucine-rich repeat extensin-like protein 2(LOC105049242) | Elaeis guineensis | - | - | - | - | IPR001611:Leucine-rich repeat;IPR003591:Leucine-rich repeat; typical subtype; |
| CNU23_00003083-RA | CNU23_00003083 | maker-COCO01-augustus-gene-2.1-mRNA-1 | XP_019708847 | Uncharacterized protein LOC109506353 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003084-RA | CNU23_00003084 | maker-COCO01-augustus-gene-2.168-mRNA-1 | XP_010927126 | zinc finger CCCH domain-containing protein 46(LOC105049246) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | egu03013:Nucleocytoplasmic transport; | IPR000571:Zinc finger; CCCH-type; |
| CNU23_00003085-RA | CNU23_00003085 | maker-COCO01-augustus-gene-2.165-mRNA-1 | XP_010927124 | LOW QUALITY PROTEIN: uncharacterized protein LOC105049245 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003086-RA | CNU23_00003086 | genemark-COCO01-processed-gene-2.65-mRNA-1 | XP_019707372 | uncharacterized LOC105049243(LOC105049243) | Elaeis guineensis | - | - | - | - | IPR006869:Domain of unknown function DUF547;IPR025757:Ternary complex factor MIP1; leucine-zipper; |
| CNU23_00003087-RA | CNU23_00003087 | maker-COCO01-augustus-gene-2.28-mRNA-1 | XP_010927122 | leucine-rich repeat extensin-like protein 2(LOC105049242) | Elaeis guineensis | - | - | - | - | IPR001611:Leucine-rich repeat;IPR003591:Leucine-rich repeat; typical subtype; |
| CNU23_00003088-RA | CNU23_00003088 | maker-COCO01-augustus-gene-2.8-mRNA-1 | XP_019708847 | Uncharacterized protein LOC109506353 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003089-RA | CNU23_00003089 | maker-COCO01-augustus-gene-2.170-mRNA-1 | XP_010927126 | zinc finger CCCH domain-containing protein 46(LOC105049246) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | egu03013:Nucleocytoplasmic transport; | IPR000571:Zinc finger; CCCH-type; |
| CNU23_00003090-RA | CNU23_00003090 | maker-COCO01-augustus-gene-2.166-mRNA-1 | XP_010927124 | LOW QUALITY PROTEIN: uncharacterized protein LOC105049245 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003091-RA | CNU23_00003091 | genemark-COCO01-processed-gene-2.131-mRNA-1 | XP_019707372 | uncharacterized LOC105049243(LOC105049243) | Elaeis guineensis | - | - | - | - | IPR006869:Domain of unknown function DUF547;IPR025757:Ternary complex factor MIP1; leucine-zipper; |
| CNU23_00003092-RA | CNU23_00003092 | maker-COCO01-augustus-gene-2.40-mRNA-1 | XP_010922985 | UBP1-associated protein 2A-like(LOC105046160) | Elaeis guineensis | - | - | RNA binding [GO:0003723] | - | IPR000504:RNA recognition motif domain;IPR012677:Nucleotide-binding; alpha-beta plait; |
| CNU23_00003093-RA | CNU23_00003093 | genemark-COCO01-processed-gene-2.141-mRNA-1 | XP_038970185 | uncharacterized LOC120104034(LOC120104034) | Phoenix dactylifera | transposition [GO:0032196] | - | - | - | - |
| CNU23_00003094-RA | CNU23_00003094 | maker-COCO01-augustus-gene-3.6-mRNA-1 | XP_018681438 | vacuolar cation/proton exchanger 3-like(LOC103983977) | Musa acuminata | - | - | - | - | IPR004713:Calcium/proton exchanger;IPR004798:Calcium/proton exchanger CAX;IPR004837:Sodium/calcium exchanger membrane region; |
| CNU23_00003095-RA | CNU23_00003095 | genemark-COCO01-processed-gene-2.152-mRNA-1 | XP_010927131 | protein PHOSPHATE STARVATION RESPONSE 3(LOC105049248) | Elaeis guineensis | - | - | DNA binding [GO:0003677]; DNA-binding transcription factor activity [GO:0003700] | - | IPR006447:Myb domain; plants;IPR009057:Homeodomain-like;IPR017930:Myb domain;IPR025756:MYB-CC type transcription factor; LHEQLE-containing domain; |
| CNU23_00003096-RA | CNU23_00003096 | genemark-COCO01-processed-gene-2.157-mRNA-1 | XP_010927136 | uncharacterized LOC105049249(LOC105049249) | Elaeis guineensis | - | - | ATPase activator activity [GO:0001671]; protein-folding chaperone binding [GO:0051087] | - | IPR015310:Activator of Hsp90 ATPase; N-terminal; |
| CNU23_00003097-RA | CNU23_00003097 | maker-COCO01-augustus-gene-3.4-mRNA-1 | XP_010927142 | uncharacterized LOC105049253(LOC105049253) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003098-RA | CNU23_00003098 | augustus-COCO01-processed-gene-3.116-mRNA-1 | XP_010927142 | uncharacterized LOC105049253(LOC105049253) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003100-RA | CNU23_00003100 | maker-COCO01-augustus-gene-3.0-mRNA-1 | XP_010913398 | Protein disulfide isomerase-like 2-3 | Elaeis guineensis var. tenera (Oil palm) | - | - | protein disulfide isomerase activity [GO:0003756] | egu04141:Protein processing in endoplasmic reticulum; | IPR005788;IPR044569;IPR036249;IPR017937;IPR013766; |
| CNU23_00003099-RA | CNU23_00003099 | maker-COCO01-augustus-gene-3.1-mRNA-1 | XP_010928244 | uncharacterized LOC105050081(LOC105050081) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR021924:Protein of unknown function DUF3537; |
| CNU23_000003100-RA | CNU23_000003100 | maker-COCO01-augustus-gene-3.0-mRNA-1 | XP_017700559 | Uncharacterized mitochondrial protein AtMg00810-like | Phoenix dactylifera (Date palm) | - | - | - | - | IPR043502;IPR013103; |
| CNU23_00003101-RA | CNU23_00003101 | maker-COCO01-augustus-gene-3.31-mRNA-1 | XP_016502944 | uncharacterized LOC107821066(LOC107821066) | Nicotiana tabacum | - | - | - | - | IPR025312:Domain of unknown function DUF4216; |
| CNU23_00003102-RA | CNU23_00003102 | maker-COCO01-augustus-gene-3.58-mRNA-1 | XP_010927147 | Uncharacterized protein LOC105049254 isoform X2 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003103-RA | CNU23_00003103 | maker-COCO01-augustus-gene-3.2-mRNA-1 | XP_010927150 | Uncharacterized protein LOC105049256 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003104-RA | CNU23_00003104 | augustus-COCO01-processed-gene-3.130-mRNA-1 | XP_010917638 | 3-ketoacyl-CoA synthase 11(LOC105042214) | Elaeis guineensis | fatty acid biosynthetic process [GO:0006633] | membrane [GO:0016020] | acyltransferase activity; transferring groups other than amino-acyl groups [GO:0016747] | egu00062:Fatty acid elongation;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites;egu04626:Plant-pathogen interaction; | IPR012392:Very-long-chain 3-ketoacyl-CoA synthase;IPR013601:FAE1/Type III polyketide synthase-like protein;IPR013747:3-Oxoacyl-[acyl-carrier-protein (ACP)] synthase III C-terminal;IPR016039:Thiolase-like; |
| CNU23_00003105-RA | CNU23_00003105 | maker-COCO01-augustus-gene-3.66-mRNA-1 | XP_010910716 | ethylene-responsive transcription factor ERF017(LOC105036666) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; DNA-binding transcription factor activity [GO:0003700] | - | IPR001471:AP2/ERF domain;IPR016177:DNA-binding; integrase-type; |
| CNU23_00003106-RA | CNU23_00003106 | maker-COCO01-augustus-gene-3.3-mRNA-1 | XP_010926601 | 4-coumarate--CoA ligase (EC 6.2.1.12) | Elaeis guineensis var. tenera (Oil palm) | phenylpropanoid metabolic process [GO:0009698] | - | 4-coumarate-CoA ligase activity [GO:0016207]; trans-cinnamate-CoA ligase activity [GO:0106290] | - | IPR025110;IPR045851;IPR020845;IPR000873;IPR042099; |
| CNU23_00003107-RA | CNU23_00003107 | maker-COCO01-augustus-gene-4.4-mRNA-1 | XP_010913805 | squamosa promoter-binding-like protein 12(LOC105039362) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; metal ion binding [GO:0046872] | - | IPR004333:Transcription factor; SBP-box; |
| CNU23_00003108-RA | CNU23_00003108 | maker-COCO01-augustus-gene-4.0-mRNA-1 | XP_010913805 | squamosa promoter-binding-like protein 12(LOC105039362) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; metal ion binding [GO:0046872] | - | IPR004333:Transcription factor; SBP-box; |
| CNU23_00003109-RA | CNU23_00003109 | maker-COCO01-augustus-gene-4.3-mRNA-1 | XP_010929421 | ranBP2-type zinc finger protein At1g67325(LOC105050899) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR001876:Zinc finger; RanBP2-type; |
| CNU23_00003110-RA | CNU23_00003110 | maker-COCO01-augustus-gene-4.21-mRNA-1 | XP_038986529 | uncharacterized LOC120112020(LOC120112020) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003111-RA | CNU23_00003111 | maker-COCO01-augustus-gene-4.25-mRNA-1 | XP_010910998 | E3 ubiquitin protein ligase RIE1-like(LOC105036984) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003112-RA | CNU23_00003112 | maker-COCO01-augustus-gene-4.36-mRNA-1 | XP_010917354 | F-box/kelch-repeat protein At1g57790 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR036047; |
| CNU23_00003113-RA | CNU23_00003113 | maker-COCO01-augustus-gene-5.6-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_000003119-RA | CNU23_000003119 | maker-COCO01-augustus-gene-5.3-mRNA-1 | XP_029120759 | Uncharacterized protein LOC114914223 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR023213;IPR013103; |
| CNU23_00003114-RA | CNU23_00003114 | maker-COCO01-augustus-gene-5.24-mRNA-1 | XP_019106172 | - | - | - | - | - | - | - |
| CNU23_00003115-RA | CNU23_00003115 | maker-COCO01-augustus-gene-5.10-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003116-RA | CNU23_00003116 | maker-COCO01-augustus-gene-5.0-mRNA-1 | XP_010927159 | uncharacterized LOC105049262(LOC105049262) | Elaeis guineensis | - | membrane [GO:0016020] | DNA binding [GO:0003677]; lipid binding [GO:0008289] | - | IPR002913:START domain;IPR023393:START-like domain; |
| CNU23_00003117-RA | CNU23_00003117 | maker-COCO01-augustus-gene-5.1-mRNA-1 | XP_010927161 | aspartate--tRNA ligase 2; cytoplasmic(LOC105049264) | Elaeis guineensis | aspartyl-tRNA aminoacylation [GO:0006422] | cytoplasm [GO:0005737] | aspartate-tRNA ligase activity [GO:0004815]; ATP binding [GO:0005524] | egu00970:Aminoacyl-tRNA biosynthesis; | IPR002312:Aspartyl/Asparaginyl-tRNA synthetase; class IIb;IPR004364:Aminoacyl-tRNA synthetase; class II (D/K/N);IPR004523:Aspartyl-tRNA synthetases;IPR006195:Aminoacyl-tRNA synthetase; class II;IPR012340:Nucleic acid-binding; OB-fold; |
| CNU23_00003118-RA | CNU23_00003118 | maker-COCO01-augustus-gene-5.2-mRNA-1 | XP_019707279 | cycloartenol Synthase-like(LOC105049266) | Elaeis guineensis | triterpenoid biosynthetic process [GO:0016104] | lipid droplet [GO:0005811] | intramolecular transferase activity [GO:0016866] | egu00100:Steroid biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR002365:Terpene synthase; conserved site;IPR008930:Terpenoid cyclases/protein prenyltransferase alpha-alpha toroid;IPR018333:Squalene cyclase; |
| CNU23_00003119-RA | CNU23_00003119 | maker-COCO01-augustus-gene-5.3-mRNA-1 | XP_010927168 | Uncharacterized protein LOC105049268 | Elaeis guineensis var. tenera (Oil palm) | - | membrane [GO:0016020] | - | - | IPR021924; |
| CNU23_00003120-RA | CNU23_00003120 | maker-COCO01-augustus-gene-6.160-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003121-RA | CNU23_00003121 | maker-COCO01-augustus-gene-6.59-mRNA-1 | XP_010927169 | UDP-N-acetylglucosamine transferase subunit ALG13 homolog(LOC105049269) | Elaeis guineensis | - | - | hexosyltransferase activity [GO:0016758] | egu00510:N-Glycan biosynthesis;egu00513:Various types of N-glycan biosynthesis;egu01100:Metabolic pathways; | IPR007235:Glycosyl transferase; family 28; C-terminal; |
| CNU23_00003122-RA | CNU23_00003122 | genemark-COCO01-processed-gene-6.75-mRNA-1 | XP_010927172 | protein APEM9(LOC105049270) | Elaeis guineensis | peroxisomal membrane transport [GO:0015919] | membrane [GO:0016020] | - | - | - |
| CNU23_00003123-RA | CNU23_00003123 | maker-COCO01-augustus-gene-6.162-mRNA-1 | XP_019707763 | U-box domain-containing protein 35(LOC105050589) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein kinase activity [GO:0004672] | - | IPR000719:Protein kinase; catalytic domain;IPR006016:UspA;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR014729:Rossmann-like alpha/beta/alpha sandwich fold; |
| CNU23_00003124-RA | CNU23_00003124 | maker-COCO01-augustus-gene-6.169-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003125-RA | CNU23_00003125 | genemark-COCO01-processed-gene-6.91-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003126-RA | CNU23_00003126 | maker-COCO01-augustus-gene-6.170-mRNA-1 | XP_010927174 | biotin carboxylase 1; chloroplastic(LOC105049274) | Elaeis guineensis | fatty acid biosynthetic process [GO:0006633]; malonyl-CoA biosynthetic process [GO:2001295] | - | acetyl-CoA carboxylase activity [GO:0003989]; ATP binding [GO:0005524]; biotin carboxylase activity [GO:0004075]; metal ion binding [GO:0046872] | egu00061:Fatty acid biosynthesis;egu00620:Pyruvate metabolism;egu00640:Propanoate metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites;egu01200:Carbon metabolism;egu01212:Fatty acid metabolism; | IPR004549:Acetyl-CoA carboxylase; biotin carboxylase;IPR005479:Carbamoyl-phosphate synthetase large subunit-like; ATP-binding domain;IPR005481:Carbamoyl-phosphate synthase; large subunit; N-terminal;IPR005482:Biotin carboxylase; C-terminal;IPR011054:Rudiment single hybrid motif;IPR011761:ATP-grasp fold;IPR011764:Biotin carboxylation domain;IPR013815:ATP-grasp fold; subdomain 1;IPR016185:Pre-ATP-grasp domain; |
| CNU23_00003127-RA | CNU23_00003127 | maker-COCO01-augustus-gene-6.164-mRNA-1 | XP_010927177 | uncharacterized LOC105049275(LOC105049275) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003128-RA | CNU23_00003128 | genemark-COCO01-processed-gene-6.141-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003129-RA | CNU23_00003129 | genemark-COCO01-processed-gene-6.100-mRNA-1 | XP_010927178 | cytochrome P450 CYP73A100(LOC105049276) | Elaeis guineensis | - | - | heme binding [GO:0020037]; iron ion binding [GO:0005506]; monooxygenase activity [GO:0004497]; oxidoreductase activity; acting on paired donors; with incorporation or reduction of molecular oxygen [GO:0016705] | egu00130:Ubiquinone and other terpenoid-quinone biosynthesis;egu00940:Phenylpropanoid biosynthesis;egu00941:Flavonoid biosynthesis;egu00945:Stilbenoid; diarylheptanoid and gingerol biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR001128:Cytochrome P450;IPR002401:Cytochrome P450; E-class; group I;IPR017972:Cytochrome P450; conserved site; |
| CNU23_00003130-RA | CNU23_00003130 | genemark-COCO01-processed-gene-6.142-mRNA-1 | XP_010927179 | DExH-box ATP-dependent RNA helicase DExH10(LOC105049277) | Elaeis guineensis | RNA catabolic process [GO:0006401] | - | ATP binding [GO:0005524]; hydrolase activity [GO:0016787]; RNA binding [GO:0003723]; RNA helicase activity [GO:0003724] | egu03018:RNA degradation; | IPR001650:Helicase; C-terminal;IPR011545:DNA/RNA helicase; DEAD/DEAH box type; N-terminal;IPR012961:DSH; C-terminal;IPR014001:Helicase; superfamily 1/2; ATP-binding domain;IPR016438:RNA helicase; ATP-dependent; SK12/DOB1;IPR025696:rRNA-processing arch domain;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003131-RA | CNU23_00003131 | maker-COCO01-augustus-gene-6.34-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003132-RA | CNU23_00003132 | maker-COCO01-augustus-gene-6.166-mRNA-1 | XP_010927181 | proteasome subunit beta type-6(LOC105049278) | Elaeis guineensis | proteolysis involved in protein catabolic process [GO:0051603] | cytoplasm [GO:0005737]; nucleus [GO:0005634]; proteasome core complex [GO:0005839] | threonine-type endopeptidase activity [GO:0004298] | egu03050:Proteasome; | IPR000243:Peptidase T1A; proteasome beta-subunit;IPR001353:Proteasome; subunit alpha/beta;IPR016050:Proteasome; beta-type subunit; conserved site;IPR023333:Proteasome B-type subunit; |
| CNU23_00003133-RA | CNU23_00003133 | genemark-COCO01-processed-gene-6.106-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003134-RA | CNU23_00003134 | maker-COCO01-augustus-gene-6.168-mRNA-1 | XP_010910963 | AIG2-like protein D(LOC105036945) | Elaeis guineensis | - | - | acyltransferase activity [GO:0016746] | - | IPR009288:AIG2-like;IPR013024:Butirosin biosynthesis; BtrG-like; |
| CNU23_00003135-RA | CNU23_00003135 | genemark-COCO01-processed-gene-6.154-mRNA-1 | XP_010927183 | auxin response factor 19(LOC105049281) | Elaeis guineensis | auxin-activated signaling pathway [GO:0009734]; regulation of DNA-templated transcription [GO:0006355] | nucleus [GO:0005634] | DNA binding [GO:0003677] | - | IPR000270:Phox/Bem1p;IPR003340:B3 DNA binding domain;IPR010525:Auxin response factor;IPR015300:DNA-binding pseudobarrel domain; |
| CNU23_00003136-RA | CNU23_00003136 | maker-COCO01-augustus-gene-7.6-mRNA-1 | XP_010905564 | sugar transport protein MST6(LOC105032731) | Elaeis guineensis | - | membrane [GO:0016020] | monosaccharide transmembrane transporter activity [GO:0015145]; symporter activity [GO:0015293] | - | IPR003663:Sugar/inositol transporter;IPR005828:General substrate transporter;IPR005829:Sugar transporter; conserved site;IPR020846:Major facilitator superfamily domain; |
| CNU23_00003137-RA | CNU23_00003137 | maker-COCO01-augustus-gene-7.106-mRNA-1 | XP_010927185 | L-arabinokinase(LOC105049282) | Elaeis guineensis | organic substance metabolic process [GO:0071704]; primary metabolic process [GO:0044238] | - | ATP binding [GO:0005524] | egu00520:Amino sugar and nucleotide sugar metabolism;egu01100:Metabolic pathways;egu01250:Biosynthesis of nucleotide sugars; | IPR006204:GHMP kinase N-terminal domain;IPR012369:Galactokinase; glycosyltransferase;IPR013750:GHMP kinase; C-terminal domain;IPR014721:Ribosomal protein S5 domain 2-type fold; subgroup;IPR019539:Galactokinase galactose-binding domain;IPR020568:Ribosomal protein S5 domain 2-type fold; |
| CNU23_00003138-RA | CNU23_00003138 | genemark-COCO01-processed-gene-7.59-mRNA-1 | XP_019707476 | methyl-CpG-binding domain-containing protein 2(LOC105049283) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; zinc ion binding [GO:0008270] | - | IPR001739:Methyl-CpG DNA binding;IPR011124:Zinc finger; CW-type;IPR016177:DNA-binding; integrase-type; |
| CNU23_00003139-RA | CNU23_00003139 | maker-COCO01-augustus-gene-7.34-mRNA-1 | XP_010910725 | Uncharacterized protein LOC105036675 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR036410; |
| CNU23_00003140-RA | CNU23_00003140 | genemark-COCO01-processed-gene-7.78-mRNA-1 | XP_010927188 | isoamylase 1; chloroplastic(LOC105049284) | Elaeis guineensis | carbohydrate metabolic process [GO:0005975]; macromolecule metabolic process [GO:0043170] | - | isoamylase activity [GO:0019156] | egu00500:Starch and sucrose metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR004193:Glycoside hydrolase; family 13; N-terminal;IPR006047:Glycosyl hydrolase; family 13; catalytic domain;IPR013780:Glycosyl hydrolase; family 13; all-beta;IPR013783:Immunoglobulin-like fold;IPR014756:Immunoglobulin E-set;IPR017853:Glycoside hydrolase; superfamily; |
| CNU23_00003141-RA | CNU23_00003141 | maker-COCO01-augustus-gene-7.105-mRNA-1 | XP_010930207 | uncharacterized LOC105051451(LOC105051451) | Elaeis guineensis | - | - | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003142-RA | CNU23_00003142 | maker-COCO01-augustus-gene-8.6-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003143-RA | CNU23_00003143 | maker-COCO01-augustus-gene-8.0-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003144-RA | CNU23_00003144 | maker-COCO01-augustus-gene-8.32-mRNA-1 | XP_019702910 | uncharacterized LOC109505143(LOC109505143) | Elaeis guineensis | - | - | - | - | IPR005162:Retrotransposon gag protein; |
| CNU23_00003145-RA | CNU23_00003145 | maker-COCO01-augustus-gene-8.33-mRNA-1 | XP_010927192 | auxin-induced protein 6B(LOC105049286) | Elaeis guineensis | response to auxin [GO:0009733] | - | - | - | IPR003676:Auxin responsive SAUR protein; |
| CNU23_00003146-RA | CNU23_00003146 | genemark-COCO01-processed-gene-8.53-mRNA-1 | XP_010927193 | uncharacterized LOC105049287(LOC105049287) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR006747:Protein of unknown function DUF599; |
| CNU23_00003147-RA | CNU23_00003147 | maker-COCO01-augustus-gene-8.1-mRNA-1 | XP_010927280 | cation transporter HKT1-like(LOC105049357) | Elaeis guineensis | inorganic cation transmembrane transport [GO:0098662]; metal ion transport [GO:0030001] | membrane [GO:0016020] | monoatomic cation transmembrane transporter activity [GO:0008324] | - | IPR003445:Cation transporter; |
| CNU23_00003148-RA | CNU23_00003148 | maker-COCO01-augustus-gene-8.2-mRNA-1 | XP_010927195 | uncharacterized LOC105049290(LOC105049290) | Elaeis guineensis | - | - | helicase activity [GO:0004386] | - | IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003149-RA | CNU23_00003149 | genemark-COCO01-processed-gene-9.6-mRNA-1 | XP_010929391 | probable mitochondrial adenine nucleotide transporter BTL1(LOC105050878) | Elaeis guineensis | nitrogen compound transport [GO:0071705]; organic anion transport [GO:0015711]; organophosphate ester transport [GO:0015748]; transmembrane transport [GO:0055085] | membrane [GO:0016020] | - | - | IPR002067:Mitochondrial carrier protein;IPR018108:Mitochondrial substrate/solute carrier;IPR023395:Mitochondrial carrier domain; |
| CNU23_00003150-RA | CNU23_00003150 | genemark-COCO01-processed-gene-9.7-mRNA-1 | XP_010927200 | 60S acidic ribosomal protein P3(LOC105049292) | Elaeis guineensis | translational elongation [GO:0006414] | ribonucleoprotein complex [GO:1990904]; ribosome [GO:0005840] | structural constituent of ribosome [GO:0003735] | egu03010:Ribosome; | IPR027534:Ribosomal protein L12 family; |
| CNU23_00003151-RA | CNU23_00003151 | maker-COCO01-augustus-gene-9.12-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003152-RA | CNU23_00003152 | maker-COCO01-augustus-gene-9.13-mRNA-1 | XP_010927201 | splicing factor 3B subunit 1(LOC105049293) | Elaeis guineensis | spliceosomal complex assembly [GO:0000245] | spliceosomal complex [GO:0005681] | mRNA binding [GO:0003729] | egu03040:Spliceosome; | IPR011989:Armadillo-like helical;IPR015016:Splicing factor 3B subunit 1;IPR016024:Armadillo-type fold;IPR021133:HEAT; type 2; |
| CNU23_00003153-RA | CNU23_00003153 | maker-COCO01-augustus-gene-9.59-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003154-RA | CNU23_00003154 | maker-COCO01-augustus-gene-9.3-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003155-RA | CNU23_00003155 | genemark-COCO01-processed-gene-9.30-mRNA-1 | XP_010927205 | uncharacterized LOC105049295(LOC105049295) | Elaeis guineensis | - | - | - | - | IPR001466:Beta-lactamase-related;IPR004147:UbiB domain;IPR011009:Protein kinase-like domain;IPR012338:Beta-lactamase/transpeptidase-like; |
| CNU23_00003156-RA | CNU23_00003156 | maker-COCO01-augustus-gene-9.30-mRNA-1 | XP_029121621 | pentatricopeptide repeat-containing protein At2g34400(LOC105049298) | Elaeis guineensis | RNA modification [GO:0009451] | - | RNA binding [GO:0003723] | - | - |
| CNU23_00003157-RA | CNU23_00003157 | genemark-COCO01-processed-gene-9.67-mRNA-1 | XP_010927210 | uncharacterized LOC105049300(LOC105049300) | Elaeis guineensis | - | - | - | - | IPR001810:F-box domain; cyclin-like; |
| CNU23_00003158-RA | CNU23_00003158 | genemark-COCO01-processed-gene-10.9-mRNA-1 | XP_010940175 | ATP-dependent RNA helicase-like protein DB10(LOC105058818) | Elaeis guineensis | - | - | ATP binding [GO:0005524]; hydrolase activity [GO:0016787]; RNA binding [GO:0003723]; RNA helicase activity [GO:0003724] | egu03040:Spliceosome; | IPR000629:RNA helicase; ATP-dependent; DEAD-box; conserved site;IPR001202:WW domain;IPR001650:Helicase; C-terminal;IPR011545:DNA/RNA helicase; DEAD/DEAH box type; N-terminal;IPR014001:Helicase; superfamily 1/2; ATP-binding domain;IPR014014:RNA helicase; DEAD-box type; Q motif;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003159-RA | CNU23_00003159 | genemark-COCO01-processed-gene-10.11-mRNA-1 | XP_010932660 | DEAD-box ATP-dependent RNA helicase 38(LOC105053260) | Elaeis guineensis | - | - | ATP binding [GO:0005524]; hydrolase activity [GO:0016787]; RNA binding [GO:0003723]; RNA helicase activity [GO:0003724] | egu03013:Nucleocytoplasmic transport;egu03015:mRNA surveillance pathway; | IPR001650:Helicase; C-terminal;IPR011545:DNA/RNA helicase; DEAD/DEAH box type; N-terminal;IPR014001:Helicase; superfamily 1/2; ATP-binding domain;IPR014014:RNA helicase; DEAD-box type; Q motif;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003160-RA | CNU23_00003160 | maker-COCO01-augustus-gene-10.2-mRNA-1 | XP_029121620 | putative inactive cadmium/zinc-transporting ATPase HMA3(LOC105049304) | Elaeis guineensis | - | membrane [GO:0016020] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887]; ATPase-coupled monoatomic cation transmembrane transporter activity [GO:0019829]; metal ion binding [GO:0046872] | - | - |
| CNU23_00003161-RA | CNU23_00003161 | maker-COCO01-augustus-gene-10.35-mRNA-1 | XP_010925527 | uncharacterized LOC105048034(LOC105048034) | Elaeis guineensis | - | - | - | - | IPR000477:Reverse transcriptase; |
| CNU23_00003162-RA | CNU23_00003162 | maker-COCO01-augustus-gene-10.3-mRNA-1 | XP_010927215 | uncharacterized LOC105049306(LOC105049306) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003163-RA | CNU23_00003163 | genemark-COCO01-processed-gene-10.65-mRNA-1 | XP_019707283 | NAC domain-containing protein 79 isoform X1 | Elaeis guineensis var. tenera (Oil palm) | regulation of DNA-templated transcription [GO:0006355] | - | DNA binding [GO:0003677] | - | IPR003441;IPR036093; |
| CNU23_00003164-RA | CNU23_00003164 | maker-COCO01-augustus-gene-10.56-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003165-RA | CNU23_00003165 | genemark-COCO01-processed-gene-10.48-mRNA-1 | XP_029121618 | glycosyltransferase BC10(LOC105049309) | Elaeis guineensis | - | membrane [GO:0016020] | glycosyltransferase activity [GO:0016757] | - | - |
| CNU23_00003166-RA | CNU23_00003166 | maker-COCO01-augustus-gene-10.64-mRNA-1 | XP_038984464 | uncharacterized LOC120111480(LOC120111480) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003167-RA | CNU23_00003167 | genemark-COCO01-processed-gene-10.58-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003168-RA | CNU23_00003168 | genemark-COCO01-processed-gene-11.47-mRNA-1 | XP_010927223 | subtilisin-like protease SBT2.5(LOC105049312) | Elaeis guineensis | proteolysis [GO:0006508] | - | serine-type endopeptidase activity [GO:0004252] | - | IPR000209:Peptidase S8/S53 domain;IPR010259:Proteinase inhibitor I9;IPR015500:Peptidase S8; subtilisin-related;IPR023827:Peptidase S8; subtilisin; Asp-active site;IPR023828:Peptidase S8; subtilisin; Ser-active site; |
| CNU23_00003169-RA | CNU23_00003169 | maker-COCO01-augustus-gene-11.120-mRNA-1 | XP_010927227 | DNA-binding protein BIN4(LOC105049313) | Elaeis guineensis | DNA endoreduplication [GO:0042023] | DNA topoisomerase type II (double strand cut; ATP-hydrolyzing) complex [GO:0009330] | double-stranded DNA binding [GO:0003690] | - | - |
| CNU23_00003170-RA | CNU23_00003170 | genemark-COCO01-processed-gene-11.53-mRNA-1 | XP_010927232 | uncharacterized LOC105049315(LOC105049315) | Elaeis guineensis | - | - | - | - | IPR000195:Rab-GTPase-TBC domain; |
| CNU23_00003171-RA | CNU23_00003171 | maker-COCO01-augustus-gene-11.127-mRNA-1 | XP_010929374 | 7-dehydrocholesterol reductase(LOC105050866) | Elaeis guineensis | sterol biosynthetic process [GO:0016126] | membrane [GO:0016020] | oxidoreductase activity; acting on the CH-CH group of donors; NAD or NADP as acceptor [GO:0016628] | egu00100:Steroid biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR001171:Ergosterol biosynthesis ERG4/ERG24;IPR018083:Sterol reductase; conserved site; |
| CNU23_00003172-RA | CNU23_00003172 | genemark-COCO01-processed-gene-11.55-mRNA-1 | XP_010927236 | E3 ubiquitin-protein ligase MARCH8(LOC105049316) | Elaeis guineensis | - | membrane [GO:0016020] | zinc ion binding [GO:0008270] | - | IPR011016:Zinc finger; RING-CH-type;IPR013083:Zinc finger; RING/FYVE/PHD-type; |
| CNU23_00003173-RA | CNU23_00003173 | maker-COCO01-augustus-gene-11.123-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003174-RA | CNU23_00003174 | augustus-COCO01-processed-gene-11.9-mRNA-1 | XP_010929360 | pathogenesis-related homeodomain protein(LOC105050862) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; metal ion binding [GO:0046872] | - | IPR001356:Homeodomain;IPR001965:Zinc finger; PHD-type;IPR009057:Homeodomain-like;IPR011011:Zinc finger; FYVE/PHD-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR019786:Zinc finger; PHD-type; conserved site;IPR019787:Zinc finger; PHD-finger; |
| CNU23_00003175-RA | CNU23_00003175 | maker-COCO01-augustus-gene-11.124-mRNA-1 | XP_010927238 | pathogenesis-related homeodomain protein(LOC105049318) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; metal ion binding [GO:0046872] | - | IPR001356:Homeodomain;IPR001965:Zinc finger; PHD-type;IPR009057:Homeodomain-like;IPR011011:Zinc finger; FYVE/PHD-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR019786:Zinc finger; PHD-type; conserved site;IPR019787:Zinc finger; PHD-finger; |
| CNU23_00003176-RA | CNU23_00003176 | maker-COCO01-augustus-gene-11.125-mRNA-1 | XP_010927238 | pathogenesis-related homeodomain protein(LOC105049318) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA binding [GO:0003677]; metal ion binding [GO:0046872] | - | IPR001356:Homeodomain;IPR001965:Zinc finger; PHD-type;IPR009057:Homeodomain-like;IPR011011:Zinc finger; FYVE/PHD-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR019786:Zinc finger; PHD-type; conserved site;IPR019787:Zinc finger; PHD-finger; |
| CNU23_00003177-RA | CNU23_00003177 | genemark-COCO01-processed-gene-11.101-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003178-RA | CNU23_00003178 | genemark-COCO01-processed-gene-11.102-mRNA-1 | XP_029121608 | probable aminodeoxychorismate synthase; chloroplastic(LOC105049360) | Elaeis guineensis | folic acid biosynthetic process [GO:0046656]; glutamine metabolic process [GO:0006541]; tetrahydrofolate biosynthetic process [GO:0046654] | - | transferase activity [GO:0016740] | egu00790:Folate biosynthesis;egu01240:Biosynthesis of cofactors; | IPR005801:ADC synthase;IPR005802:Para-aminobenzoate synthase; component I;IPR006221:Anthranilate synthase/para-aminobenzoate synthase like domain;IPR006805:Anthranilate synthase component I; N-terminal;IPR015890:Chorismate binding; C-terminal;IPR017926:Glutamine amidotransferase;IPR019999:Anthranilate synthase component I; |
| CNU23_00003179-RA | CNU23_00003179 | maker-COCO01-augustus-gene-11.130-mRNA-1 | XP_010927243 | protein CHLOROPLAST IMPORT APPARATUS 2(LOC105049321) | Elaeis guineensis | - | nucleus [GO:0005634] | - | - | IPR010402:CCT domain; |
| CNU23_00003180-RA | CNU23_00003180 | maker-COCO01-augustus-gene-12.0-mRNA-1 | XP_010927246 | centromere-associated protein E(LOC105049322) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003181-RA | CNU23_00003181 | maker-COCO01-augustus-gene-12.32-mRNA-1 | XP_010927247 | B-box zinc finger protein 32(LOC105049323) | Elaeis guineensis | - | - | zinc ion binding [GO:0008270] | - | IPR000315:Zinc finger; B-box; |
| CNU23_00003182-RA | CNU23_00003182 | genemark-COCO01-processed-gene-12.97-mRNA-1 | XP_010927248 | beta-glucuronosyltransferase GlcAT14A(LOC105049324) | Elaeis guineensis | - | membrane [GO:0016020] | glucuronosyltransferase activity [GO:0015020] | - | IPR003406:Glycosyl transferase; family 14; |
| CNU23_00003183-RA | CNU23_00003183 | maker-COCO01-augustus-gene-12.1-mRNA-1 | XP_010928708 | uncharacterized LOC105050408(LOC105050408) | Elaeis guineensis | - | - | - | - | IPR012349:FMN-binding split barrel; |
| CNU23_00003184-RA | CNU23_00003184 | genemark-COCO01-processed-gene-12.103-mRNA-1 | XP_010927248 | beta-glucuronosyltransferase GlcAT14A(LOC105049324) | Elaeis guineensis | - | membrane [GO:0016020] | glucuronosyltransferase activity [GO:0015020] | - | IPR003406:Glycosyl transferase; family 14; |
| CNU23_00003185-RA | CNU23_00003185 | maker-COCO01-augustus-gene-12.2-mRNA-1 | XP_010927250 | uncharacterized LOC105049325(LOC105049325) | Elaeis guineensis | - | - | - | - | IPR012349:FMN-binding split barrel; |
| CNU23_00003186-RA | CNU23_00003186 | maker-COCO01-augustus-gene-12.106-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003187-RA | CNU23_00003187 | genemark-COCO01-processed-gene-12.110-mRNA-1 | XP_010927251 | transcription factor bHLH35(LOC105049326) | Elaeis guineensis | - | - | protein dimerization activity [GO:0046983] | - | IPR002912:ACT domain;IPR011598:Myc-type; basic helix-loop-helix (bHLH) domain; |
| CNU23_00003188-RA | CNU23_00003188 | maker-COCO01-augustus-gene-12.3-mRNA-1 | XP_010927252 | KH domain-containing protein HEN4(LOC105049327) | Elaeis guineensis | - | - | RNA binding [GO:0003723] | - | IPR004087:K Homology domain;IPR004088:K Homology domain; type 1; |
| CNU23_00003189-RA | CNU23_00003189 | genemark-COCO01-processed-gene-13.10-mRNA-1 | XP_010927253 | GATA transcription factor 20(LOC105049329) | Elaeis guineensis | regulation of DNA-templated transcription [GO:0006355] | nucleus [GO:0005634] | sequence-specific DNA binding [GO:0043565]; zinc ion binding [GO:0008270] | - | IPR000679:Zinc finger; GATA-type;IPR010399:Tify;IPR010402:CCT domain;IPR013088:Zinc finger; NHR/GATA-type; |
| CNU23_00003190-RA | CNU23_00003190 | genemark-COCO01-processed-gene-13.21-mRNA-1 | XP_010927257 | protein SMAX1-LIKE 4(LOC105049331) | Elaeis guineensis | - | - | - | - | IPR004176:Clp; N-terminal;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003191-RA | CNU23_00003191 | maker-COCO01-augustus-gene-13.7-mRNA-1 | XP_019707440 | protein TRANSPARENT TESTA 9-like(LOC105049332) | Elaeis guineensis | - | - | - | - | IPR016024:Armadillo-type fold;IPR019155:Uncharacterised protein family FPL; |
| CNU23_00003192-RA | CNU23_00003192 | maker-COCO01-augustus-gene-13.2-mRNA-1 | XP_010927258 | serrate RNA effector molecule(LOC105049333) | Elaeis guineensis | mRNA processing [GO:0006397] | nucleus [GO:0005634] | - | - | IPR007042:Arsenite-resistance protein 2;IPR013087:Zinc finger C2H2-type/integrase DNA-binding domain;IPR021933:Protein of unknown function DUF3546; |
| CNU23_00003193-RA | CNU23_00003193 | genemark-COCO01-processed-gene-13.33-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003194-RA | CNU23_00003194 | maker-COCO01-augustus-gene-13.26-mRNA-1 | XP_010927262 | 7-deoxyloganetin glucosyltransferase(LOC105049338) | Elaeis guineensis | - | - | UDP-glycosyltransferase activity [GO:0008194] | - | IPR002213:UDP-glucuronosyl/UDP-glucosyltransferase; |
| CNU23_00003195-RA | CNU23_00003195 | genemark-COCO01-processed-gene-13.60-mRNA-1 | XP_029120841 | UDP-glycosyltransferase 83A1(LOC105046642) | Elaeis guineensis | - | - | UDP-glycosyltransferase activity [GO:0008194] | - | - |
| CNU23_00003196-RA | CNU23_00003196 | genemark-COCO01-processed-gene-13.96-mRNA-1 | XP_038978844 | Uncharacterized protein LOC120109168 | Phoenix dactylifera (Date palm) | - | - | - | - | - |
| CNU23_00003197-RA | CNU23_00003197 | maker-COCO01-augustus-gene-14.0-mRNA-1 | XP_010927264 | zinc finger CCCH domain-containing protein 40(LOC105049340) | Elaeis guineensis | - | - | metal ion binding [GO:0046872]; RNA binding [GO:0003723] | egu03040:Spliceosome; | IPR000504:RNA recognition motif domain;IPR000571:Zinc finger; CCCH-type;IPR012677:Nucleotide-binding; alpha-beta plait; |
| CNU23_00003198-RA | CNU23_00003198 | maker-COCO01-augustus-gene-14.1-mRNA-1 | XP_029121603 | calcium-transporting ATPase 5; plasma membrane-type(LOC105049341) | Elaeis guineensis | - | membrane [GO:0016020] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887]; calmodulin binding [GO:0005516]; P-type calcium transporter activity [GO:0005388] | - | - |
| CNU23_00003199-RA | CNU23_00003199 | maker-COCO01-augustus-gene-14.7-mRNA-1 | XP_010927268 | choline monooxygenase; chloroplastic(LOC105049342) | Elaeis guineensis | glycine betaine biosynthetic process from choline [GO:0019285] | chloroplast stroma [GO:0009570] | 2 iron; 2 sulfur cluster binding [GO:0051537]; choline monooxygenase activity [GO:0019133]; iron ion binding [GO:0005506] | egu00260:Glycine; serine and threonine metabolism;egu01100:Metabolic pathways; | IPR001663:Aromatic-ring-hydroxylating dioxygenase; alpha subunit;IPR015879:Aromatic-ring-hydroxylating dioxygenase; alpha subunit; C-terminal domain;IPR017941:Rieske [2Fe-2S] iron-sulphur domain; |
| CNU23_00003200-RA | CNU23_00003200 | maker-COCO01-augustus-gene-14.2-mRNA-1 | XP_010927258 | serrate RNA effector molecule(LOC105049333) | Elaeis guineensis | mRNA processing [GO:0006397] | nucleus [GO:0005634] | - | - | IPR007042:Arsenite-resistance protein 2;IPR013087:Zinc finger C2H2-type/integrase DNA-binding domain;IPR021933:Protein of unknown function DUF3546; |
| CNU23_00003201-RA | CNU23_00003201 | genemark-COCO01-processed-gene-14.25-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003202-RA | CNU23_00003202 | maker-COCO01-augustus-gene-14.80-mRNA-1 | XP_010927262 | 7-deoxyloganetin glucosyltransferase(LOC105049338) | Elaeis guineensis | - | - | UDP-glycosyltransferase activity [GO:0008194] | - | IPR002213:UDP-glucuronosyl/UDP-glucosyltransferase; |
| CNU23_00003203-RA | CNU23_00003203 | genemark-COCO01-processed-gene-14.88-mRNA-1 | XP_038978844 | Uncharacterized protein LOC120109168 | Phoenix dactylifera (Date palm) | - | - | - | - | - |
| CNU23_00003204-RA | CNU23_00003204 | maker-COCO01-augustus-gene-14.5-mRNA-1 | XP_010927264 | zinc finger CCCH domain-containing protein 40(LOC105049340) | Elaeis guineensis | - | - | metal ion binding [GO:0046872]; RNA binding [GO:0003723] | egu03040:Spliceosome; | IPR000504:RNA recognition motif domain;IPR000571:Zinc finger; CCCH-type;IPR012677:Nucleotide-binding; alpha-beta plait; |
| CNU23_00003205-RA | CNU23_00003205 | maker-COCO01-augustus-gene-14.6-mRNA-1 | XP_029121603 | calcium-transporting ATPase 5; plasma membrane-type(LOC105049341) | Elaeis guineensis | - | membrane [GO:0016020] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887]; calmodulin binding [GO:0005516]; P-type calcium transporter activity [GO:0005388] | - | - |
| CNU23_00003206-RA | CNU23_00003206 | maker-COCO01-augustus-gene-14.9-mRNA-1 | XP_010927268 | choline monooxygenase; chloroplastic(LOC105049342) | Elaeis guineensis | glycine betaine biosynthetic process from choline [GO:0019285] | chloroplast stroma [GO:0009570] | 2 iron; 2 sulfur cluster binding [GO:0051537]; choline monooxygenase activity [GO:0019133]; iron ion binding [GO:0005506] | egu00260:Glycine; serine and threonine metabolism;egu01100:Metabolic pathways; | IPR001663:Aromatic-ring-hydroxylating dioxygenase; alpha subunit;IPR015879:Aromatic-ring-hydroxylating dioxygenase; alpha subunit; C-terminal domain;IPR017941:Rieske [2Fe-2S] iron-sulphur domain; |
| CNU23_00003207-RA | CNU23_00003207 | maker-COCO01-augustus-gene-15.4-mRNA-1 | XP_010906743 | uncharacterized LOC105033578(LOC105033578) | Elaeis guineensis | - | - | - | - | IPR005162:Retrotransposon gag protein; |
| CNU23_00003208-RA | CNU23_00003208 | maker-COCO01-augustus-gene-15.139-mRNA-1 | XP_010929324 | protein MANNAN SYNTHESIS-RELATED 1(LOC105050840) | Elaeis guineensis | fucose metabolic process [GO:0006004] | - | transferase activity [GO:0016740] | - | IPR019378:GDP-fucose protein O-fucosyltransferase;IPR024709:O-fucosyltransferase; plant; |
| CNU23_00003209-RA | CNU23_00003209 | genemark-COCO01-processed-gene-15.44-mRNA-1 | XP_019707324 | plant intracellular Ras-group-related LRR protein 1-like(LOC105049344) | Elaeis guineensis | - | - | - | - | IPR001611:Leucine-rich repeat;IPR003591:Leucine-rich repeat; typical subtype; |
| CNU23_00003210-RA | CNU23_00003210 | genemark-COCO01-processed-gene-15.63-mRNA-1 | XP_010916896 | UDP-glycosyltransferase 88A1(LOC105041627) | Elaeis guineensis | - | - | UDP-glycosyltransferase activity [GO:0008194] | - | IPR002213:UDP-glucuronosyl/UDP-glucosyltransferase; |
| CNU23_00003211-RA | CNU23_00003211 | maker-COCO01-augustus-gene-15.137-mRNA-1 | XP_029121602 | coatomer subunit beta-1(LOC105049345) | Elaeis guineensis | intracellular protein transport [GO:0006886]; vesicle-mediated transport [GO:0016192] | COPI vesicle coat [GO:0030126]; Golgi membrane [GO:0000139] | structural molecule activity [GO:0005198] | - | - |
| CNU23_00003212-RA | CNU23_00003212 | augustus-COCO01-processed-gene-15.23-mRNA-1 | XP_010929320 | nucleotide-sugar uncharacterized transporter 2(LOC105050838) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR004853:Domain of unknown function DUF250; |
| CNU23_00003213-RA | CNU23_00003213 | maker-COCO01-augustus-gene-16.2-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003214-RA | CNU23_00003214 | augustus-COCO01-processed-gene-16.116-mRNA-1 | XP_010927273 | uncharacterized LOC105049347(LOC105049347) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003215-RA | CNU23_00003215 | maker-COCO01-augustus-gene-16.18-mRNA-1 | XP_010927274 | exocyst complex component EXO70A1-like(LOC105049349) | Elaeis guineensis | exocytosis [GO:0006887]; protein transport [GO:0015031] | exocyst [GO:0000145] | phosphatidylinositol-4;5-bisphosphate binding [GO:0005546] | - | IPR004140:Exocyst complex protein Exo70;IPR016159:Cullin repeat-like-containing domain; |
| CNU23_00003216-RA | CNU23_00003216 | maker-COCO01-augustus-gene-16.22-mRNA-1 | XP_010927275 | WRKY transcription factor WRKY51(LOC105049350) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA-binding transcription factor activity [GO:0003700]; sequence-specific DNA binding [GO:0043565] | - | IPR003657:DNA-binding WRKY;IPR018872:Zn-cluster domain; |
| CNU23_00003217-RA | CNU23_00003217 | maker-COCO01-augustus-gene-17.13-mRNA-1 | XP_009385962 | uncharacterized LOC103973186(LOC103973186) | Musa acuminata | - | - | - | - | - |
| CNU23_00003218-RA | CNU23_00003218 | maker-COCO01-augustus-gene-17.0-mRNA-1 | XP_019707344 | heavy metal-associated isoprenylated plant protein 43-like(LOC109506104) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR006121:Heavy metal-associated domain; HMA; |
| CNU23_00003219-RA | CNU23_00003219 | maker-COCO01-augustus-gene-17.1-mRNA-1 | XP_019707344 | heavy metal-associated isoprenylated plant protein 43-like(LOC109506104) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR006121:Heavy metal-associated domain; HMA; |
| CNU23_00003220-RA | CNU23_00003220 | genemark-COCO01-processed-gene-18.116-mRNA-1 | XP_038974056 | uncharacterized LOC120105559(LOC120105559) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003221-RA | CNU23_00003221 | maker-COCO01-augustus-gene-18.26-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003222-RA | CNU23_00003222 | maker-COCO01-augustus-gene-18.0-mRNA-1 | XP_010911519 | WAT1-related protein At5g07050(LOC105037571) | Elaeis guineensis | - | membrane [GO:0016020] | transmembrane transporter activity [GO:0022857] | - | IPR000620:Drug/metabolite transporter; |
| CNU23_00003223-RA | CNU23_00003223 | maker-COCO01-augustus-gene-18.2-mRNA-1 | XP_019707460 | probable protein phosphatase 2C 59(LOC105049180) | Elaeis guineensis | protein dephosphorylation [GO:0006470] | - | metal ion binding [GO:0046872]; myosin phosphatase activity [GO:0017018] | - | IPR000222:Protein phosphatase 2C; manganese/magnesium aspartate binding site;IPR001932:Protein phosphatase 2C (PP2C)-like; |
| CNU23_00003224-RA | CNU23_00003224 | maker-COCO01-augustus-gene-18.3-mRNA-1 | XP_010911519 | WAT1-related protein At5g07050(LOC105037571) | Elaeis guineensis | - | membrane [GO:0016020] | transmembrane transporter activity [GO:0022857] | - | IPR000620:Drug/metabolite transporter; |
| CNU23_00003225-RA | CNU23_00003225 | maker-COCO01-augustus-gene-19.1-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003226-RA | CNU23_00003226 | maker-COCO01-augustus-gene-19.2-mRNA-1 | XP_010927051 | glutaredoxin-C8(LOC105049182) | Elaeis guineensis | - | - | - | - | IPR002109:Glutaredoxin;IPR011767:Glutaredoxin active site;IPR011899:Glutaredoxin; eukaryotic/virial;IPR014025:Glutaredoxin subgroup; |
| CNU23_00003227-RA | CNU23_00003227 | genemark-COCO01-processed-gene-19.82-mRNA-1 | XP_010927052 | uncharacterized LOC105049185(LOC105049185) | Elaeis guineensis | - | nucleus [GO:0005634] | histone H3K36me/H3K36me2 demethylase activity [GO:0140680]; iron ion binding [GO:0005506] | - | IPR003347:JmjC domain;IPR013109:Lysine-specific demethylase NO66/MYC-induced nuclear antigen;IPR016024:Armadillo-type fold; |
| CNU23_00003228-RA | CNU23_00003228 | genemark-COCO01-processed-gene-19.83-mRNA-1 | XP_010927053 | homeobox-leucine zipper protein HOX18(LOC105049186) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA-binding transcription factor activity; RNA polymerase II-specific [GO:0000981]; sequence-specific DNA binding [GO:0043565] | - | IPR001356:Homeodomain;IPR003106:Leucine zipper; homeobox-associated;IPR009057:Homeodomain-like;IPR017970:Homeobox; conserved site; |
| CNU23_00003229-RA | CNU23_00003229 | maker-COCO01-augustus-gene-19.5-mRNA-1 | XP_010911519 | WAT1-related protein At5g07050(LOC105037571) | Elaeis guineensis | - | membrane [GO:0016020] | transmembrane transporter activity [GO:0022857] | - | IPR000620:Drug/metabolite transporter; |
| CNU23_00003230-RA | CNU23_00003230 | maker-COCO01-augustus-gene-19.6-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003231-RA | CNU23_00003231 | maker-COCO01-augustus-gene-19.7-mRNA-1 | XP_010927051 | glutaredoxin-C8(LOC105049182) | Elaeis guineensis | - | - | - | - | IPR002109:Glutaredoxin;IPR011767:Glutaredoxin active site;IPR011899:Glutaredoxin; eukaryotic/virial;IPR014025:Glutaredoxin subgroup; |
| CNU23_00003232-RA | CNU23_00003232 | genemark-COCO01-processed-gene-19.118-mRNA-1 | XP_010927052 | uncharacterized LOC105049185(LOC105049185) | Elaeis guineensis | - | nucleus [GO:0005634] | histone H3K36me/H3K36me2 demethylase activity [GO:0140680]; iron ion binding [GO:0005506] | - | IPR003347:JmjC domain;IPR013109:Lysine-specific demethylase NO66/MYC-induced nuclear antigen;IPR016024:Armadillo-type fold; |
| CNU23_00003233-RA | CNU23_00003233 | genemark-COCO01-processed-gene-20.0-mRNA-1 | XP_010927053 | homeobox-leucine zipper protein HOX18(LOC105049186) | Elaeis guineensis | - | nucleus [GO:0005634] | DNA-binding transcription factor activity; RNA polymerase II-specific [GO:0000981]; sequence-specific DNA binding [GO:0043565] | - | IPR001356:Homeodomain;IPR003106:Leucine zipper; homeobox-associated;IPR009057:Homeodomain-like;IPR017970:Homeobox; conserved site; |
| CNU23_00003234-RA | CNU23_00003234 | maker-COCO01-augustus-gene-20.19-mRNA-1 | XP_020987654 | - | - | - | - | - | - | - |
| CNU23_00003235-RA | CNU23_00003235 | maker-COCO01-augustus-gene-20.74-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003236-RA | CNU23_00003236 | maker-COCO01-augustus-gene-20.75-mRNA-1 | XP_042450597 | uncharacterized LOC122035246(LOC122035246) | Zingiber officinale | - | - | - | - | - |
| CNU23_00003237-RA | CNU23_00003237 | maker-COCO01-augustus-gene-20.76-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003238-RA | CNU23_00003238 | genemark-COCO01-processed-gene-20.38-mRNA-1 | XP_010927056 | probable xyloglucan endotransglucosylase/hydrolase protein 23(LOC105049188) | Elaeis guineensis | cell wall biogenesis [GO:0042546]; cell wall organization [GO:0071555]; xyloglucan metabolic process [GO:0010411] | apoplast [GO:0048046] | hydrolase activity; hydrolyzing O-glycosyl compounds [GO:0004553]; xyloglucan:xyloglucosyl transferase activity [GO:0016762] | - | IPR000757:Glycoside hydrolase; family 16;IPR008263:Glycoside hydrolase; family 16; active site;IPR010713:Xyloglucan endo-transglycosylase; C-terminal;IPR013320:Concanavalin A-like lectin/glucanase; subgroup;IPR016455:Xyloglucan endotransglucosylase/hydrolase; |
| CNU23_00003239-RA | CNU23_00003239 | genemark-COCO01-processed-gene-20.53-mRNA-1 | XP_010927058 | probable xyloglucan endotransglucosylase/hydrolase protein 23(LOC105049190) | Elaeis guineensis | cell wall biogenesis [GO:0042546]; cell wall organization [GO:0071555]; xyloglucan metabolic process [GO:0010411] | apoplast [GO:0048046] | hydrolase activity; hydrolyzing O-glycosyl compounds [GO:0004553]; xyloglucan:xyloglucosyl transferase activity [GO:0016762] | egu04075:Plant hormone signal transduction; | IPR000757:Glycoside hydrolase; family 16;IPR008263:Glycoside hydrolase; family 16; active site;IPR008264:Beta-glucanase;IPR010713:Xyloglucan endo-transglycosylase; C-terminal;IPR013320:Concanavalin A-like lectin/glucanase; subgroup;IPR016455:Xyloglucan endotransglucosylase/hydrolase; |
| CNU23_00003240-RA | CNU23_00003240 | maker-COCO01-augustus-gene-20.92-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003241-RA | CNU23_00003241 | maker-COCO01-augustus-gene-21.80-mRNA-1 | XP_010927061 | ribosomal RNA processing protein 1 homolog(LOC105049194) | Elaeis guineensis | rRNA processing [GO:0006364] | nucleus [GO:0005634]; preribosome; small subunit precursor [GO:0030688] | - | - | IPR010301:Nucleolar; Nop52; |
| CNU23_00003242-RA | CNU23_00003242 | genemark-COCO01-processed-gene-21.9-mRNA-1 | XP_010927063 | uncharacterized LOC105049196(LOC105049196) | Elaeis guineensis | - | - | nuclease activity [GO:0004518] | - | IPR007346:Endonuclease I; |
| CNU23_00003243-RA | CNU23_00003243 | genemark-COCO01-processed-gene-21.37-mRNA-1 | XP_010927065 | villin-5(LOC105049197) | Elaeis guineensis | actin filament capping [GO:0051693]; actin filament organization [GO:0007015] | cytoskeleton [GO:0005856] | actin filament binding [GO:0051015] | - | IPR003128:Villin headpiece;IPR007122:Villin/Gelsolin;IPR007123:Gelsolin domain; |
| CNU23_00003244-RA | CNU23_00003244 | maker-COCO01-augustus-gene-21.95-mRNA-1 | XP_010927066 | apoptosis-inducing factor homolog B(LOC105049198) | Elaeis guineensis | - | - | oxidoreductase activity [GO:0016491] | - | IPR023753:Pyridine nucleotide-disulphide oxidoreductase; FAD/NAD(P)-binding domain; |
| CNU23_00003245-RA | CNU23_00003245 | maker-COCO01-augustus-gene-21.41-mRNA-1 | XP_010927067 | chromo domain-containing protein cec-1(LOC105049199) | Elaeis guineensis | - | - | calmodulin binding [GO:0005516] | - | IPR012417:Calmodulin-binding domain; plant; |
| CNU23_00003246-RA | CNU23_00003246 | maker-COCO01-augustus-gene-21.8-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003247-RA | CNU23_00003247 | maker-COCO01-augustus-gene-21.2-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003248-RA | CNU23_00003248 | genemark-COCO01-processed-gene-21.53-mRNA-1 | XP_010927068 | uncharacterized LOC105049200(LOC105049200) | Elaeis guineensis | - | - | metal ion binding [GO:0046872]; ubiquitin protein ligase activity [GO:0061630] | - | IPR001841:Zinc finger; RING-type;IPR013083:Zinc finger; RING/FYVE/PHD-type; |
| CNU23_00003249-RA | CNU23_00003249 | maker-COCO01-augustus-gene-21.97-mRNA-1 | XP_010927071 | uncharacterized LOC105049202(LOC105049202) | Elaeis guineensis | - | nucleus [GO:0005634]; SAGA-type complex [GO:0070461] | - | - | IPR024738:Transcriptional coactivator Hfi1/Transcriptional adapter 1; |
| CNU23_00003250-RA | CNU23_00003250 | genemark-COCO01-processed-gene-21.96-mRNA-1 | XP_010927073 | putative glucose-6-phosphate 1-epimerase(LOC105049203) | Elaeis guineensis | carbohydrate metabolic process [GO:0005975] | - | carbohydrate binding [GO:0030246]; glucose-6-phosphate 1-epimerase activity [GO:0047938] | egu00010:Glycolysis / Gluconeogenesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR008183:Aldose 1-/Glucose-6-phosphate 1-epimerase;IPR011013:Galactose mutarotase-like domain;IPR014718:Glycoside hydrolase-type carbohydrate-binding; subgroup;IPR025532:Glucose-6-phosphate 1-epimerase; |
| CNU23_00003251-RA | CNU23_00003251 | maker-COCO01-augustus-gene-21.53-mRNA-1 | XP_010911220 | uncharacterized LOC105037227(LOC105037227) | Elaeis guineensis | - | - | - | - | IPR025558:Domain of unknown function DUF4283; |
| CNU23_00003252-RA | CNU23_00003252 | maker-COCO01-augustus-gene-21.5-mRNA-1 | XP_010927076 | ubiquitin carboxyl-terminal hydrolase 2(LOC105049205) | Elaeis guineensis | protein deubiquitination [GO:0016579]; ubiquitin-dependent protein catabolic process [GO:0006511] | - | cysteine-type deubiquitinase activity [GO:0004843] | - | IPR001578:Peptidase C12; ubiquitin carboxyl-terminal hydrolase 1;IPR017390:Ubiquitinyl hydrolase; UCH37 type; |
| CNU23_00003253-RA | CNU23_00003253 | maker-COCO01-augustus-gene-22.142-mRNA-1 | XP_010941662 | 14 kDa zinc-binding protein(LOC105059873) | Elaeis guineensis | - | - | adenylylsulfatase activity [GO:0047627] | - | IPR001310:Histidine triad (HIT) protein;IPR011146:HIT-like domain;IPR019808:Histidine triad; conserved site; |
| CNU23_00003254-RA | CNU23_00003254 | maker-COCO01-augustus-gene-22.143-mRNA-1 | XP_010927077 | ruBisCO large subunit-binding protein subunit alpha(LOC105049206) | Elaeis guineensis | protein refolding [GO:0042026] | - | ATP binding [GO:0005524]; ATP-dependent protein folding chaperone [GO:0140662] | - | IPR001844:Chaperonin Cpn60;IPR002423:Chaperonin Cpn60/TCP-1;IPR018370:Chaperonin Cpn60; conserved site;IPR027409:GroEL-like apical domain;IPR027410:TCP-1-like chaperonin intermediate domain;IPR027413:GroEL-like equatorial domain; |
| CNU23_00003255-RA | CNU23_00003255 | maker-COCO01-augustus-gene-22.137-mRNA-1 | XP_010927081 | myosin-9(LOC105049208) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003256-RA | CNU23_00003256 | genemark-COCO01-processed-gene-22.14-mRNA-1 | XP_029121597 | protein NARROW LEAF 1(LOC105049211) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003257-RA | CNU23_00003257 | genemark-COCO01-processed-gene-22.23-mRNA-1 | XP_010923122 | beta-glucosidase BoGH3B(LOC105046272) | Elaeis guineensis | carbohydrate metabolic process [GO:0005975] | - | beta-glucosidase activity [GO:0008422]; scopolin beta-glucosidase activity [GO:0102483] | egu00460:Cyanoamino acid metabolism;egu00500:Starch and sucrose metabolism;egu00999:Biosynthesis of various plant secondary metabolites;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR001764:Glycoside hydrolase; family 3; N-terminal;IPR002772:Glycoside hydrolase family 3 C-terminal domain;IPR017853:Glycoside hydrolase; superfamily;IPR019800:Glycoside hydrolase; family 3; active site; |
| CNU23_00003258-RA | CNU23_00003258 | maker-COCO01-augustus-gene-22.144-mRNA-1 | XP_010923123 | transcription factor DIVARICATA(LOC105046273) | Elaeis guineensis | - | - | DNA binding [GO:0003677] | - | IPR001005:SANT/Myb domain;IPR006447:Myb domain; plants;IPR009057:Homeodomain-like;IPR017884:SANT domain;IPR017930:Myb domain; |
| CNU23_00003259-RA | CNU23_00003259 | genemark-COCO01-processed-gene-22.78-mRNA-1 | XP_010923124 | laccase-22(LOC105046275) | Elaeis guineensis | lignin catabolic process [GO:0046274] | apoplast [GO:0048046] | copper ion binding [GO:0005507]; hydroquinone:oxygen oxidoreductase activity [GO:0052716] | - | IPR001117:Multicopper oxidase; type 1;IPR002355:Multicopper oxidase; copper-binding site;IPR008972:Cupredoxin;IPR011706:Multicopper oxidase; type 2;IPR011707:Multicopper oxidase; type 3;IPR017761:Laccase; |
| CNU23_00003260-RA | CNU23_00003260 | maker-COCO01-augustus-gene-22.141-mRNA-1 | XP_010927089 | lecithin-cholesterol acyltransferase-like 4(LOC105049212) | Elaeis guineensis | lipid metabolic process [GO:0006629] | - | O-acyltransferase activity [GO:0008374] | egu00564:Glycerophospholipid metabolism;egu00592:alpha-Linolenic acid metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR003386:Lecithin:cholesterol/phospholipid:diacylglycerol acyltransferase; |
| CNU23_00003261-RA | CNU23_00003261 | maker-COCO01-augustus-gene-22.146-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003262-RA | CNU23_00003262 | maker-COCO01-augustus-gene-23.138-mRNA-1 | XP_010927091 | phosphatase IMPL1; chloroplastic(LOC105049214) | Elaeis guineensis | inositol biosynthetic process [GO:0006021]; phosphatidylinositol phosphate biosynthetic process [GO:0046854] | - | inositol monophosphate 1-phosphatase activity [GO:0008934]; inositol monophosphate 3-phosphatase activity [GO:0052832]; inositol monophosphate 4-phosphatase activity [GO:0052833]; metal ion binding [GO:0046872] | egu00562:Inositol phosphate metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites;egu04070:Phosphatidylinositol signaling system; | IPR000760:Inositol monophosphatase;IPR020552:Inositol monophosphatase; Lithium-sensitive;IPR020583:Inositol monophosphatase; metal-binding site; |
| CNU23_00003263-RA | CNU23_00003263 | maker-COCO01-augustus-gene-23.140-mRNA-1 | XP_010927098 | uncharacterized protein PHLOEM PROTEIN 2-LIKE A4(LOC105049218) | Elaeis guineensis | - | - | - | - | IPR025886:Phloem protein 2-like; |
| CNU23_00003264-RA | CNU23_00003264 | maker-COCO01-augustus-gene-23.141-mRNA-1 | XP_010927098 | uncharacterized protein PHLOEM PROTEIN 2-LIKE A4(LOC105049218) | Elaeis guineensis | - | - | - | - | IPR025886:Phloem protein 2-like; |
| CNU23_00003265-RA | CNU23_00003265 | genemark-COCO01-processed-gene-23.65-mRNA-1 | XP_010941632 | ribonuclease H2 subunit C(LOC105059857) | Elaeis guineensis | RNA catabolic process [GO:0006401] | ribonuclease H2 complex [GO:0032299] | - | egu03030:DNA replication; | IPR013924:Ribonuclease H2; subunit C; |
| CNU23_00003266-RA | CNU23_00003266 | maker-COCO01-augustus-gene-23.143-mRNA-1 | XP_010941629 | porphobilinogen deaminase; chloroplastic(LOC105059855) | Elaeis guineensis | peptidyl-pyrromethane cofactor linkage [GO:0018160]; protoporphyrinogen IX biosynthetic process [GO:0006782] | - | hydroxymethylbilane synthase activity [GO:0004418] | egu00860:Porphyrin metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites;egu01240:Biosynthesis of cofactors; | IPR000860:Tetrapyrrole biosynthesis; hydroxymethylbilane synthase;IPR022417:Porphobilinogen deaminase; N-terminal;IPR022418:Porphobilinogen deaminase; C-terminal;IPR022419:Porphobilinogen deaminase; dipyrromethane cofactor binding site; |
| CNU23_00003267-RA | CNU23_00003267 | maker-COCO01-augustus-gene-23.19-mRNA-1 | XP_038971146 | uncharacterized LOC120104296(LOC120104296) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003268-RA | CNU23_00003268 | maker-COCO01-augustus-gene-23.144-mRNA-1 | XP_010927102 | putative E3 ubiquitin-protein ligase LIN(LOC105049222) | Elaeis guineensis | - | - | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003269-RA | CNU23_00003269 | genemark-COCO01-processed-gene-24.8-mRNA-1 | XP_019707424 | molybdenum cofactor sulfurase(LOC105049235) | Elaeis guineensis | Mo-molybdopterin cofactor biosynthetic process [GO:0006777]; monocarboxylic acid metabolic process [GO:0032787] | - | lyase activity [GO:0016829]; Mo-molybdopterin cofactor sulfurase activity [GO:0008265]; molybdenum cofactor sulfurtransferase activity [GO:0102867]; molybdenum ion binding [GO:0030151]; pyridoxal phosphate binding [GO:0030170] | egu00790:Folate biosynthesis;egu01100:Metabolic pathways; | IPR000192:Aminotransferase; class V/Cysteine desulfurase;IPR005302:Molybdenum cofactor sulfurase; C-terminal;IPR005303:MOSC; N-terminal beta barrel;IPR011037:Pyruvate kinase-like; insert domain;IPR015421:Pyridoxal phosphate-dependent transferase; major region; subdomain 1;IPR015422:Pyridoxal phosphate-dependent transferase; major region; subdomain 2;IPR015424:Pyridoxal phosphate-dependent transferase; |
| CNU23_00003270-RA | CNU23_00003270 | maker-COCO01-augustus-gene-23.49-mRNA-1 | XP_010935083 | protein NUCLEAR FUSION DEFECTIVE 4(LOC105055074) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR010658:Nodulin-like; |
| CNU23_00003271-RA | CNU23_00003271 | maker-COCO01-augustus-gene-24.126-mRNA-1 | XP_010941823 | protein JASON(LOC105059978) | Elaeis guineensis | male meiosis II [GO:0007142] | - | - | - | - |
| CNU23_00003272-RA | CNU23_00003272 | maker-COCO01-augustus-gene-24.127-mRNA-1 | XP_010941823 | protein JASON(LOC105059978) | Elaeis guineensis | male meiosis II [GO:0007142] | - | - | - | - |
| CNU23_00003273-RA | CNU23_00003273 | maker-COCO01-augustus-gene-24.20-mRNA-1 | XP_039146846 | - | - | - | - | - | - | - |
| CNU23_00003274-RA | CNU23_00003274 | maker-COCO01-augustus-gene-24.5-mRNA-1 | XP_010942077 | kinesin-like protein KIN-7I(LOC105060167) | Elaeis guineensis | microtubule-based movement [GO:0007018] | microtubule [GO:0005874] | ATP binding [GO:0005524]; microtubule binding [GO:0008017]; microtubule motor activity [GO:0003777] | egu04814:Motor proteins; | IPR001752:Kinesin; motor domain;IPR019821:Kinesin; motor region; conserved site;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003275-RA | CNU23_00003275 | genemark-COCO01-processed-gene-24.30-mRNA-1 | XP_010941616 | putative Myb family transcription factor At1g14600(LOC105059849) | Elaeis guineensis | - | - | DNA binding [GO:0003677]; DNA-binding transcription factor activity [GO:0003700] | - | IPR006447:Myb domain; plants;IPR009057:Homeodomain-like;IPR017930:Myb domain; |
| CNU23_00003276-RA | CNU23_00003276 | maker-COCO01-augustus-gene-24.128-mRNA-1 | XP_010927107 | protein FAR1-RELATED SEQUENCE 4(LOC105049226) | Elaeis guineensis | regulation of DNA-templated transcription [GO:0006355] | - | zinc ion binding [GO:0008270] | - | IPR004330:FAR1 DNA binding domain;IPR006564:Zinc finger; PMZ-type;IPR007527:Zinc finger; SWIM-type;IPR018289:MULE transposase domain; |
| CNU23_00003277-RA | CNU23_00003277 | maker-COCO01-augustus-gene-24.30-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003278-RA | CNU23_00003278 | genemark-COCO01-processed-gene-24.65-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003279-RA | CNU23_00003279 | maker-COCO01-augustus-gene-24.129-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003280-RA | CNU23_00003280 | maker-COCO01-augustus-gene-25.1-mRNA-1 | XP_008811120 | 4-hydroxyphenylpyruvate dioxygenase(LOC103722365) | Phoenix dactylifera | aromatic amino acid metabolic process [GO:0009072] | - | 4-hydroxyphenylpyruvate dioxygenase activity [GO:0003868]; metal ion binding [GO:0046872] | pda00130:Ubiquinone and other terpenoid-quinone biosynthesis;pda00350:Tyrosine metabolism;pda00360:Phenylalanine metabolism;pda01100:Metabolic pathways;pda01240:Biosynthesis of cofactors; | - |
| CNU23_00003281-RA | CNU23_00003281 | genemark-COCO01-processed-gene-25.84-mRNA-1 | XP_010941605 | protein unc-45 homolog A(LOC105059844) | Elaeis guineensis | - | - | - | - | IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003282-RA | CNU23_00003282 | maker-COCO01-augustus-gene-25.3-mRNA-1 | XP_008811120 | 4-hydroxyphenylpyruvate dioxygenase(LOC103722365) | Phoenix dactylifera | aromatic amino acid metabolic process [GO:0009072] | - | 4-hydroxyphenylpyruvate dioxygenase activity [GO:0003868]; metal ion binding [GO:0046872] | pda00130:Ubiquinone and other terpenoid-quinone biosynthesis;pda00350:Tyrosine metabolism;pda00360:Phenylalanine metabolism;pda01100:Metabolic pathways;pda01240:Biosynthesis of cofactors; | - |
| CNU23_00003283-RA | CNU23_00003283 | genemark-COCO01-processed-gene-25.139-mRNA-1 | XP_010941605 | protein unc-45 homolog A(LOC105059844) | Elaeis guineensis | - | - | - | - | IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003284-RA | CNU23_00003284 | maker-COCO01-augustus-gene-25.5-mRNA-1 | XP_008811120 | 4-hydroxyphenylpyruvate dioxygenase(LOC103722365) | Phoenix dactylifera | aromatic amino acid metabolic process [GO:0009072] | - | 4-hydroxyphenylpyruvate dioxygenase activity [GO:0003868]; metal ion binding [GO:0046872] | pda00130:Ubiquinone and other terpenoid-quinone biosynthesis;pda00350:Tyrosine metabolism;pda00360:Phenylalanine metabolism;pda01100:Metabolic pathways;pda01240:Biosynthesis of cofactors; | - |
| CNU23_00003285-RA | CNU23_00003285 | genemark-COCO01-processed-gene-25.157-mRNA-1 | XP_010941605 | protein unc-45 homolog A(LOC105059844) | Elaeis guineensis | - | - | - | - | IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003286-RA | CNU23_00003286 | genemark-COCO01-processed-gene-25.125-mRNA-1 | XP_029119521 | Uncharacterized protein LOC105042236 isoform X1 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR004252; |
| CNU23_00003287-RA | CNU23_00003287 | maker-COCO01-augustus-gene-26.3-mRNA-1 | XP_010932186 | auxin-induced protein 15A(LOC105052902) | Elaeis guineensis | response to auxin [GO:0009733] | - | - | egu04075:Plant hormone signal transduction; | IPR003676:Auxin responsive SAUR protein; |
| CNU23_00003288-RA | CNU23_00003288 | maker-COCO01-augustus-gene-26.116-mRNA-1 | XP_010907043 | peroxisome biogenesis protein 6(LOC105033814) | Elaeis guineensis | peroxisome organization [GO:0007031] | cytosol [GO:0005829] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887] | egu04146:Peroxisome; | IPR003593:AAA+ ATPase domain;IPR003959:ATPase; AAA-type; core;IPR003960:ATPase; AAA-type; conserved site;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003289-RA | CNU23_00003289 | maker-COCO01-augustus-gene-26.42-mRNA-1 | XP_010907048 | uncharacterized LOC105033816(LOC105033816) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003290-RA | CNU23_00003290 | genemark-COCO01-processed-gene-26.57-mRNA-1 | XP_019711160 | putative germin-like protein 2-1(LOC105059975) | Elaeis guineensis | - | apoplast [GO:0048046] | manganese ion binding [GO:0030145] | - | IPR001929:Germin;IPR006045:Cupin 1;IPR011051:RmlC-like cupin domain;IPR014710:RmlC-like jelly roll fold;IPR019780:Germin; manganese binding site; |
| CNU23_00003291-RA | CNU23_00003291 | maker-COCO01-augustus-gene-27.41-mRNA-1 | XP_010907048 | uncharacterized LOC105033816(LOC105033816) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003292-RA | CNU23_00003292 | maker-COCO01-augustus-gene-27.0-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003293-RA | CNU23_00003293 | maker-COCO01-augustus-gene-27.17-mRNA-1 | XP_019102749 | - | - | - | - | - | - | - |
| CNU23_00003294-RA | CNU23_00003294 | maker-COCO01-augustus-gene-28.5-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003295-RA | CNU23_00003295 | genemark-COCO01-processed-gene-28.15-mRNA-1 | XP_029117889 | uncharacterized LOC114913355(LOC114913355) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003296-RA | CNU23_00003296 | genemark-COCO01-processed-gene-28.19-mRNA-1 | XP_010905373 | tubulin beta-2 chain(LOC105032591) | Elaeis guineensis | microtubule-based process [GO:0007017] | microtubule [GO:0005874] | GTP binding [GO:0005525]; GTPase activity [GO:0003924]; structural constituent of cytoskeleton [GO:0005200] | egu04145:Phagosome;egu04814:Motor proteins; | IPR000217:Tubulin;IPR002453:Beta tubulin;IPR003008:Tubulin/FtsZ; GTPase domain;IPR008280:Tubulin/FtsZ; C-terminal;IPR017975:Tubulin; conserved site;IPR018316:Tubulin/FtsZ; 2-layer sandwich domain;IPR023123:Tubulin; C-terminal; |
| CNU23_00003297-RA | CNU23_00003297 | maker-COCO01-augustus-gene-28.19-mRNA-1 | XP_010926885 | berberine bridge enzyme-like 23(LOC105049048) | Elaeis guineensis | - | - | FAD binding [GO:0071949]; oxidoreductase activity [GO:0016491] | - | IPR006094:FAD linked oxidase; N-terminal;IPR012951:Berberine/berberine-like;IPR016166:FAD-binding; type 2;IPR016167:FAD-binding; type 2; subdomain 1;IPR016169:CO dehydrogenase flavoprotein-like; FAD-binding; subdomain 2; |
| CNU23_00003298-RA | CNU23_00003298 | maker-COCO01-augustus-gene-28.124-mRNA-1 | XP_010926886 | dihydroceramide fatty acyl 2-hydroxylase FAH1(LOC105049049) | Elaeis guineensis | fatty acid biosynthetic process [GO:0006633] | endoplasmic reticulum membrane [GO:0005789] | fatty acid alpha-hydroxylase activity [GO:0080132]; iron ion binding [GO:0005506] | - | IPR006694:Fatty acid hydroxylase;IPR014430:Inositolphosphorylceramide-B hydroxylase; |
| CNU23_00003299-RA | CNU23_00003299 | maker-COCO01-augustus-gene-28.48-mRNA-1 | XP_010908099 | protein NUCLEAR FUSION DEFECTIVE 2(LOC105034586) | Elaeis guineensis | rRNA processing [GO:0006364] | - | ribonuclease III activity [GO:0004525]; RNA binding [GO:0003723] | - | IPR000999:Ribonuclease III domain;IPR011907:Ribonuclease III; |
| |
| CNU23_00003300-RA | CNU23_00003300 | genemark-COCO01-processed-gene-28.89-mRNA-1 | XP_010926887 | patellin-4(LOC105049050) | Elaeis guineensis | cell cycle [GO:0007049]; cell division [GO:0051301] | cytoplasm [GO:0005737]; membrane [GO:0016020] | lipid binding [GO:0008289] | - | IPR001251:CRAL-TRIO domain;IPR009038:GOLD;IPR011074:CRAL/TRIO; N-terminal domain; |
| CNU23_00003301-RA | CNU23_00003301 | augustus-COCO01-processed-gene-29.10-mRNA-1 | XP_019711174 | twinkle homolog protein; chloroplastic/mitochondrial(LOC105059833) | Elaeis guineensis | DNA replication [GO:0006260] | - | 5'-3' DNA helicase activity [GO:0043139]; ATP binding [GO:0005524]; single-stranded DNA binding [GO:0003697] | - | IPR006171:Toprim domain;IPR007694:DNA helicase; DnaB-like; C-terminal;IPR027032:Twinkle protein;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003302-RA | CNU23_00003302 | maker-COCO01-augustus-gene-29.2-mRNA-1 | XP_026662506 | uncharacterized LOC113463064(LOC113463064) | Phoenix dactylifera | - | - | metal ion binding [GO:0046872] | - | - |
| CNU23_00003303-RA | CNU23_00003303 | maker-COCO01-augustus-gene-29.4-mRNA-1 | XP_019707243 | pentatricopeptide repeat-containing protein At4g20770(LOC109506064) | Elaeis guineensis | RNA modification [GO:0009451] | - | RNA binding [GO:0003723] | - | IPR002885:Pentatricopeptide repeat;IPR011990:Tetratricopeptide-like helical; |
| CNU23_00003304-RA | CNU23_00003304 | genemark-COCO01-processed-gene-29.57-mRNA-1 | XP_010923778 | thiosulfate/3-mercaptopyruvate sulfurtransferase 2(LOC105046766) | Elaeis guineensis | - | - | thiosulfate sulfurtransferase activity [GO:0004792] | egu00270:Cysteine and methionine metabolism;egu00920:Sulfur metabolism;egu01100:Metabolic pathways;egu04122:Sulfur relay system; | IPR001307:Thiosulphate sulfurtransferase; conserved site;IPR001763:Rhodanese-like domain; |
| CNU23_00003305-RA | CNU23_00003305 | genemark-COCO01-processed-gene-29.65-mRNA-1 | XP_010926889 | biotin--protein ligase 2(LOC105049052) | Elaeis guineensis | protein modification process [GO:0036211] | - | biotin-[acetyl-CoA-carboxylase] ligase activity [GO:0004077] | egu00780:Biotin metabolism;egu01100:Metabolic pathways; | IPR003142:Biotin protein ligase; C-terminal;IPR004143:Biotin/lipoate A/B protein ligase;IPR004408:Biotin--acetyl-CoA-carboxylase ligase; |
| CNU23_00003306-RA | CNU23_00003306 | maker-COCO01-augustus-gene-29.8-mRNA-1 | XP_010911106 | non-specific lipid-transfer protein C; cotyledon-specific isoform-like(LOC105037102) | Elaeis guineensis | lipid transport [GO:0006869] | - | lipid binding [GO:0008289] | - | IPR000528:Plant lipid transfer protein/Par allergen;IPR016140:Bifunctional inhibitor/plant lipid transfer protein/seed storage helical domain; |
| CNU23_00003307-RA | CNU23_00003307 | maker-COCO01-augustus-gene-29.38-mRNA-1 | XP_010926890 | GPI mannosyltransferase 1(LOC105049053) | Elaeis guineensis | GPI anchor biosynthetic process [GO:0006506] | endoplasmic reticulum membrane [GO:0005789] | alpha-1;4-mannosyltransferase activity [GO:0051751]; glycolipid mannosyltransferase activity [GO:0004376] | egu00563:Glycosylphosphatidylinositol (GPI)-anchor biosynthesis;egu01100:Metabolic pathways; | IPR007704:Mannosyltransferase; DXD; |
| CNU23_00003308-RA | CNU23_00003308 | maker-COCO01-augustus-gene-29.40-mRNA-1 | XP_010943952 | Uncharacterized protein LOC105061561 isoform X1 | Elaeis guineensis var. tenera (Oil palm) | - | - | DNA binding [GO:0003677] | - | IPR009057;IPR017930;IPR001005; |
| CNU23_00003309-RA | CNU23_00003309 | genemark-COCO01-processed-gene-29.84-mRNA-1 | XP_010926892 | protein CHUP1; chloroplastic(LOC105049055) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003310-RA | CNU23_00003310 | maker-COCO01-augustus-gene-29.7-mRNA-1 | XP_029121684 | UPF0481 protein At3g02645 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR004158; |
| CNU23_00003311-RA | CNU23_00003311 | maker-COCO01-augustus-gene-30.113-mRNA-1 | XP_010926893 | pentatricopeptide repeat-containing protein At1g30610; chloroplastic(LOC105049056) | Elaeis guineensis | chloroplast organization [GO:0009658] | - | - | - | IPR002885:Pentatricopeptide repeat;IPR011990:Tetratricopeptide-like helical; |
| CNU23_00003312-RA | CNU23_00003312 | maker-COCO01-augustus-gene-30.114-mRNA-1 | XP_019707517 | Probable UDP-arabinose 4-epimerase 2 isoform X1 | Elaeis guineensis var. tenera (Oil palm) | galactose metabolic process [GO:0006012] | membrane [GO:0016020] | UDP-glucose 4-epimerase activity [GO:0003978] | - | IPR016040;IPR036291;IPR005886; |
| CNU23_00003313-RA | CNU23_00003313 | maker-COCO01-augustus-gene-30.48-mRNA-1 | XP_010926899 | uncharacterized LOC105049060(LOC105049060) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003314-RA | CNU23_00003314 | maker-COCO01-augustus-gene-30.51-mRNA-1 | XP_010929458 | uncharacterized LOC105050926(LOC105050926) | Elaeis guineensis | - | - | - | - | IPR005162:Retrotransposon gag protein; |
| CNU23_00003315-RA | CNU23_00003315 | maker-COCO01-augustus-gene-30.115-mRNA-1 | XP_010926900 | uncharacterized LOC105049063(LOC105049063) | Elaeis guineensis | intracellular protein transport [GO:0006886] | BLOC-1 complex [GO:0031083] | - | - | IPR017246:Snapin; |
| CNU23_00003316-RA | CNU23_00003316 | maker-COCO01-augustus-gene-30.119-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003317-RA | CNU23_00003317 | maker-COCO01-augustus-gene-30.116-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003318-RA | CNU23_00003318 | genemark-COCO01-processed-gene-30.79-mRNA-1 | XP_010926904 | uncharacterized LOC105049066(LOC105049066) | Elaeis guineensis | mitochondrial translation [GO:0032543] | mitochondrion [GO:0005739] | structural constituent of ribosome [GO:0003735] | - | IPR019349:Ribosomal protein S24/S35; mitochondrial; conserved domain; |
| CNU23_00003319-RA | CNU23_00003319 | genemark-COCO01-processed-gene-30.82-mRNA-1 | XP_010926904 | uncharacterized LOC105049066(LOC105049066) | Elaeis guineensis | mitochondrial translation [GO:0032543] | mitochondrion [GO:0005739] | structural constituent of ribosome [GO:0003735] | - | IPR019349:Ribosomal protein S24/S35; mitochondrial; conserved domain; |
| CNU23_00003320-RA | CNU23_00003320 | maker-COCO01-augustus-gene-30.120-mRNA-1 | XP_010926905 | LRR receptor-like serine/threonine-protein kinase FLS2(LOC105049067) | Elaeis guineensis | protein phosphorylation [GO:0006468] | membrane [GO:0016020] | ATP binding [GO:0005524]; protein kinase activity [GO:0004672] | egu04016:MAPK signaling pathway - plant;egu04626:Plant-pathogen interaction; | IPR000719:Protein kinase; catalytic domain;IPR003591:Leucine-rich repeat; typical subtype;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR013210:Leucine-rich repeat-containing N-terminal; type 2; |
| CNU23_00003321-RA | CNU23_00003321 | maker-COCO01-augustus-gene-31.53-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003322-RA | CNU23_00003322 | maker-COCO01-augustus-gene-31.80-mRNA-1 | XP_010926911 | SART-1 family protein DOT2(LOC105049071) | Elaeis guineensis | mRNA splicing; via spliceosome [GO:0000398] | nucleus [GO:0005634] | - | egu03040:Spliceosome; | IPR005011:SART-1 protein; |
| CNU23_00003323-RA | CNU23_00003323 | genemark-COCO01-processed-gene-31.42-mRNA-1 | XP_010926911 | SART-1 family protein DOT2(LOC105049071) | Elaeis guineensis | mRNA splicing; via spliceosome [GO:0000398] | nucleus [GO:0005634] | - | egu03040:Spliceosome; | IPR005011:SART-1 protein; |
| CNU23_00003324-RA | CNU23_00003324 | maker-COCO01-augustus-gene-31.82-mRNA-1 | XP_029121582 | uncharacterized LOC105049074(LOC105049074) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | - |
| CNU23_00003325-RA | CNU23_00003325 | genemark-COCO01-processed-gene-31.69-mRNA-1 | XP_019707332 | small ubiquitin-related modifier 1-like(LOC109506098) | Elaeis guineensis | - | - | - | - | IPR000626:Ubiquitin;IPR022617:Small ubiquitin-related modifier; SUMO; |
| CNU23_00003326-RA | CNU23_00003326 | maker-COCO01-augustus-gene-31.84-mRNA-1 | XP_010926919 | metal transporter Nramp3(LOC105049075) | Elaeis guineensis | - | membrane [GO:0016020] | metal ion transmembrane transporter activity [GO:0046873] | - | IPR001046:Natural resistance-associated macrophage like; |
| CNU23_00003327-RA | CNU23_00003327 | maker-COCO01-augustus-gene-31.32-mRNA-1 | XP_010913476 | U-box domain-containing protein 41(LOC105039149) | Elaeis guineensis | protein ubiquitination [GO:0016567] | - | ubiquitin-protein transferase activity [GO:0004842] | - | IPR000225:Armadillo;IPR003613:U box domain;IPR011989:Armadillo-like helical;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR016024:Armadillo-type fold; |
| CNU23_00003328-RA | CNU23_00003328 | maker-COCO01-augustus-gene-31.85-mRNA-1 | XP_029121581 | exopolyphosphatase PRUNE1(LOC105049077) | Elaeis guineensis | - | cytoplasm [GO:0005737] | pyrophosphatase activity [GO:0016462] | egu00230:Purine metabolism;egu01100:Metabolic pathways; | - |
| CNU23_00003329-RA | CNU23_00003329 | maker-COCO01-augustus-gene-32.2-mRNA-1 | XP_029118263 | cold-responsive protein kinase 1(LOC105034121) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein serine/threonine kinase activity [GO:0004674] | - | - |
| CNU23_00003330-RA | CNU23_00003330 | maker-COCO01-augustus-gene-32.3-mRNA-1 | XP_029124471 | probable methyltransferase PMT21(LOC105059300) | Elaeis guineensis | methylation [GO:0032259] | membrane [GO:0016020] | methyltransferase activity [GO:0008168] | - | - |
| CNU23_00003331-RA | CNU23_00003331 | maker-COCO01-augustus-gene-32.0-mRNA-1 | XP_010926929 | deubiquitinase OTUD6B(LOC105049081) | Elaeis guineensis | - | - | - | - | IPR003323:Ovarian tumour; otubain; |
| CNU23_00003332-RA | CNU23_00003332 | maker-COCO01-augustus-gene-32.4-mRNA-1 | XP_029118263 | cold-responsive protein kinase 1(LOC105034121) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein serine/threonine kinase activity [GO:0004674] | - | - |
| CNU23_00003333-RA | CNU23_00003333 | maker-COCO01-augustus-gene-32.5-mRNA-1 | XP_029124471 | probable methyltransferase PMT21(LOC105059300) | Elaeis guineensis | methylation [GO:0032259] | membrane [GO:0016020] | methyltransferase activity [GO:0008168] | - | - |
| CNU23_00003334-RA | CNU23_00003334 | maker-COCO01-augustus-gene-32.1-mRNA-1 | XP_010926929 | deubiquitinase OTUD6B(LOC105049081) | Elaeis guineensis | - | - | - | - | IPR003323:Ovarian tumour; otubain; |
| CNU23_00003335-RA | CNU23_00003335 | maker-COCO01-augustus-gene-33.6-mRNA-1 | XP_010926930 | patatin-like protein 3(LOC105049082) | Elaeis guineensis | lipid catabolic process [GO:0016042] | - | lipase activity [GO:0016298] | - | IPR002641:Patatin/Phospholipase A2-related;IPR016035:Acyl transferase/acyl hydrolase/lysophospholipase; |
| CNU23_00003336-RA | CNU23_00003336 | maker-COCO01-augustus-gene-33.0-mRNA-1 | XP_010936609 | N-acetyltransferase 9-like protein(LOC105056197) | Elaeis guineensis | - | - | N-acetyltransferase activity [GO:0008080] | - | IPR000182:GNAT domain;IPR016181:Acyl-CoA N-acyltransferase; |
| CNU23_00003337-RA | CNU23_00003337 | genemark-COCO01-processed-gene-33.15-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003338-RA | CNU23_00003338 | genemark-COCO01-processed-gene-33.70-mRNA-1 | XP_010927030 | uncharacterized LOC105049157(LOC105049157) | Elaeis guineensis | - | nucleus [GO:0005634] | - | - | IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003339-RA | CNU23_00003339 | maker-COCO01-augustus-gene-33.2-mRNA-1 | XP_010906552 | Uncharacterized protein LOC105033430 isoform X2 | Elaeis guineensis var. tenera (Oil palm) | - | membrane [GO:0016020] | zinc ion binding [GO:0008270] | - | IPR011016;IPR013083; |
| CNU23_00003340-RA | CNU23_00003340 | maker-COCO01-augustus-gene-33.3-mRNA-1 | XP_010926933 | probable 3-hydroxyisobutyrate dehydrogenase; mitochondrial(LOC105049084) | Elaeis guineensis | valine catabolic process [GO:0006574] | - | 3-hydroxyisobutyrate dehydrogenase activity [GO:0008442]; NAD binding [GO:0051287]; NADP binding [GO:0050661] | egu00280:Valine; leucine and isoleucine degradation;egu00410:beta-Alanine metabolism;egu00640:Propanoate metabolism;egu01100:Metabolic pathways;egu01200:Carbon metabolism; | IPR002204:3-hydroxyisobutyrate dehydrogenase-related; conserved site;IPR006115:6-phosphogluconate dehydrogenase; NADP-binding;IPR008927:6-phosphogluconate dehydrogenase; C-terminal-like;IPR011548:3-hydroxyisobutyrate dehydrogenase;IPR013328:Dehydrogenase; multihelical; |
| CNU23_00003341-RA | CNU23_00003341 | maker-COCO01-augustus-gene-33.68-mRNA-1 | XP_028799277 | uncharacterized LOC114754652(LOC114754652) | Prosopis alba | - | - | - | - | - |
| CNU23_00003342-RA | CNU23_00003342 | maker-COCO01-augustus-gene-33.72-mRNA-1 | XP_010925527 | uncharacterized LOC105048034(LOC105048034) | Elaeis guineensis | - | - | - | - | IPR000477:Reverse transcriptase; |
| CNU23_00003343-RA | CNU23_00003343 | genemark-COCO01-processed-gene-33.43-mRNA-1 | XP_010926934 | photosystem II 10 kDa polypeptide; chloroplastic(LOC105049085) | Elaeis guineensis | photosynthesis [GO:0015979] | chloroplast thylakoid membrane [GO:0009535]; photosystem II oxygen evolving complex [GO:0009654] | - | egu00195:Photosynthesis;egu01100:Metabolic pathways; | IPR006814:Photosystem II PsbR; |
| CNU23_00003344-RA | CNU23_00003344 | maker-COCO01-augustus-gene-33.10-mRNA-1 | XP_010941555 | obg-like ATPase 1(LOC105059805) | Elaeis guineensis | - | cytoplasm [GO:0005737] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887]; GTP binding [GO:0005525]; ribosomal large subunit binding [GO:0043023] | - | IPR004095:TGS;IPR004396:Conserved hypothetical protein CHP00092;IPR006073:GTP binding domain;IPR012675:Beta-grasp domain;IPR012676:TGS-like;IPR013029:Domain of unknown function DUF933;IPR023192:TGS-like domain;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003345-RA | CNU23_00003345 | maker-COCO01-augustus-gene-33.92-mRNA-1 | XP_010926938 | probable receptor-like protein kinase At1g30570(LOC105049087) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein serine/threonine kinase activity [GO:0004674]; transmembrane receptor protein tyrosine kinase activity [GO:0004714] | - | IPR000719:Protein kinase; catalytic domain;IPR001245:Serine-threonine/tyrosine-protein kinase catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site;IPR024788:Malectin-like carbohydrate-binding domain; |
| CNU23_00003346-RA | CNU23_00003346 | maker-COCO01-augustus-gene-33.101-mRNA-1 | XP_010926940 | F-box/WD-40 repeat-containing protein At5g21040(LOC105049088) | Elaeis guineensis | - | - | - | - | IPR001680:WD40 repeat;IPR001810:F-box domain; cyclin-like;IPR015943:WD40/YVTN repeat-like-containing domain;IPR019775:WD40 repeat; conserved site;IPR020472:G-protein beta WD-40 repeat; |
| CNU23_00003347-RA | CNU23_00003347 | genemark-COCO01-processed-gene-34.45-mRNA-1 | XP_010926941 | uncharacterized CRM domain-containing protein At3g25440; chloroplastic(LOC105049089) | Elaeis guineensis | - | - | RNA binding [GO:0003723] | - | IPR001890:RNA-binding; CRM domain; |
| CNU23_00003348-RA | CNU23_00003348 | maker-COCO01-augustus-gene-34.118-mRNA-1 | XP_010907330 | N-acetyl-D-glucosamine kinase(LOC105034009) | Elaeis guineensis | - | - | N-acetylglucosamine kinase activity [GO:0045127] | - | IPR002731:ATPase; BadF/BadG/BcrA/BcrD type; |
| CNU23_00003349-RA | CNU23_00003349 | maker-COCO01-augustus-gene-34.121-mRNA-1 | XP_029121568 | WPP domain-associated protein isoform X2 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | IPR037490; |
| CNU23_00003350-RA | CNU23_00003350 | augustus-COCO01-processed-gene-34.7-mRNA-1 | XP_010927031 | uncharacterized LOC105049158(LOC105049158) | Elaeis guineensis | DNA-templated transcription termination [GO:0006353]; regulation of DNA-templated transcription [GO:0006355] | - | double-stranded DNA binding [GO:0003690] | - | IPR003690:Mitochodrial transcription termination factor-related; |
| CNU23_00003351-RA | CNU23_00003351 | genemark-COCO01-processed-gene-34.50-mRNA-1 | XP_010926949 | uncharacterized LOC105049092(LOC105049092) | Elaeis guineensis | DNA-templated transcription termination [GO:0006353]; regulation of DNA-templated transcription [GO:0006355] | - | double-stranded DNA binding [GO:0003690] | - | IPR003690:Mitochodrial transcription termination factor-related; |
| CNU23_00003352-RA | CNU23_00003352 | maker-COCO01-augustus-gene-34.122-mRNA-1 | XP_010926952 | 60S acidic ribosomal protein P0(LOC105049094) | Elaeis guineensis | ribosome biogenesis [GO:0042254] | ribonucleoprotein complex [GO:1990904]; ribosome [GO:0005840] | - | egu03010:Ribosome; | IPR001790:Ribosomal protein L10/acidic P0; |
| CNU23_00003353-RA | CNU23_00003353 | genemark-COCO01-processed-gene-34.110-mRNA-1 | XP_010926954 | serine/threonine-protein phosphatase 6 regulatory subunit 3(LOC105049096) | Elaeis guineensis | regulation of phosphoprotein phosphatase activity [GO:0043666] | - | protein phosphatase binding [GO:0019903] | - | IPR007587:SIT4 phosphatase-associated protein family;IPR016024:Armadillo-type fold; |
| CNU23_00003354-RA | CNU23_00003354 | maker-COCO01-augustus-gene-34.124-mRNA-1 | XP_010935870 | serine/threonine-protein phosphatase 6 regulatory subunit 2(LOC105055659) | Elaeis guineensis | regulation of phosphoprotein phosphatase activity [GO:0043666] | - | protein phosphatase binding [GO:0019903] | - | IPR007587:SIT4 phosphatase-associated protein family;IPR016024:Armadillo-type fold; |
| CNU23_00003355-RA | CNU23_00003355 | maker-COCO01-augustus-gene-34.119-mRNA-1 | XP_010919365 | aldehyde dehydrogenase family 3 member F1(LOC105043499) | Elaeis guineensis | cellular aldehyde metabolic process [GO:0006081] | - | oxidoreductase activity; acting on the aldehyde or oxo group of donors; NAD or NADP as acceptor [GO:0016620] | egu00010:Glycolysis / Gluconeogenesis;egu00053:Ascorbate and aldarate metabolism;egu00071:Fatty acid degradation;egu00280:Valine; leucine and isoleucine degradation;egu00310:Lysine degradation;egu00330:Arginine and proline metabolism;egu00340:Histidine metabolism;egu00380:Tryptophan metabolism;egu00410:beta-Alanine metabolism;egu00561:Glycerolipid metabolism;egu00620:Pyruvate metabolism;egu00770:Pantothenate and CoA biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites;egu01240:Biosynthesis of cofactors; | IPR012394:Aldehyde dehydrogenase NAD(P)-dependent;IPR015590:Aldehyde dehydrogenase domain;IPR016161:Aldehyde/histidinol dehydrogenase;IPR016162:Aldehyde dehydrogenase; N-terminal;IPR016163:Aldehyde dehydrogenase; C-terminal; |
| CNU23_00003356-RA | CNU23_00003356 | genemark-COCO01-processed-gene-35.33-mRNA-1 | XP_010926956 | zinc finger CCCH domain-containing protein 45(LOC105049097) | Elaeis guineensis | - | - | metal ion binding [GO:0046872]; RNA binding [GO:0003723] | egu03015:mRNA surveillance pathway; | IPR000571:Zinc finger; CCCH-type;IPR007275:YTH domain; |
| CNU23_00003357-RA | CNU23_00003357 | augustus-COCO01-processed-gene-35.129-mRNA-1 | YP_006073104 | photosystem I P700 apoprotein A1(psaA) | Elaeis guineensis | photosynthesis [GO:0015979] | chloroplast thylakoid membrane [GO:0009535]; photosystem I [GO:0009522] | 4 iron; 4 sulfur cluster binding [GO:0051539]; chlorophyll binding [GO:0016168]; electron transfer activity [GO:0009055]; magnesium ion binding [GO:0000287] | egu00195:Photosynthesis;egu01100:Metabolic pathways; | IPR001280:Photosystem I PsaA/PsaB;IPR006243:Photosystem I PsaA;IPR020586:Photosystem I PsaA/PsaB; conserved site; |
| CNU23_00003358-RA | CNU23_00003358 | maker-COCO01-augustus-gene-35.158-mRNA-1 | XP_029121563 | protein NOI4(LOC105049101) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003359-RA | CNU23_00003359 | maker-COCO01-augustus-gene-35.159-mRNA-1 | XP_010926963 | mitochondrial fission 1 protein A(LOC105049102) | Elaeis guineensis | mitochondrial fission [GO:0000266]; peroxisome fission [GO:0016559] | mitochondrial outer membrane [GO:0005741] | - | - | IPR011990:Tetratricopeptide-like helical;IPR016543:Tetratricopeptide repeat 11 Fission 1 protein;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003360-RA | CNU23_00003360 | maker-COCO01-augustus-gene-36.0-mRNA-1 | XP_010926964 | ras-associated and pleckstrin homology domains-containing protein 1(LOC105049103) | Elaeis guineensis | nucleosome assembly [GO:0006334] | nucleosome [GO:0000786]; nucleus [GO:0005634] | DNA binding [GO:0003677] | - | IPR005818:Histone H1/H5;IPR017956:AT hook; DNA-binding motif; |
| CNU23_00003361-RA | CNU23_00003361 | genemark-COCO01-processed-gene-36.56-mRNA-1 | XP_010926966 | PH; RCC1 and FYVE domains-containing protein 1(LOC105049105) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR000306:Zinc finger; FYVE-type;IPR000408:Regulator of chromosome condensation; RCC1;IPR001849:Pleckstrin homology domain;IPR009091:Regulator of chromosome condensation 1/beta-lactamase-inhibitor protein II;IPR011011:Zinc finger; FYVE/PHD-type;IPR011993:Pleckstrin homology-like domain;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR013591:Brevis radix-like domain;IPR017455:Zinc finger; FYVE-related; |
| CNU23_00003362-RA | CNU23_00003362 | maker-COCO01-augustus-gene-36.6-mRNA-1 | XP_010926967 | Uncharacterized protein LOC105049106 isoform X2 | Elaeis guineensis var. tenera (Oil palm) | - | nucleus [GO:0005634] | DNA binding [GO:0003677] | - | IPR009057;IPR001356; |
| CNU23_00003363-RA | CNU23_00003363 | maker-COCO01-augustus-gene-36.1-mRNA-1 | XP_010926969 | two-component response regulator ORR9(LOC105049107) | Elaeis guineensis | cytokinin-activated signaling pathway [GO:0009736]; phosphorelay signal transduction system [GO:0000160] | - | - | egu04075:Plant hormone signal transduction; | IPR001789:Signal transduction response regulator; receiver domain;IPR011006:CheY-like superfamily; |
| CNU23_00003364-RA | CNU23_00003364 | genemark-COCO01-processed-gene-36.79-mRNA-1 | XP_010926970 | beta-galactosidase(LOC105049109) | Elaeis guineensis | carbohydrate metabolic process [GO:0005975]; organic substance catabolic process [GO:1901575] | beta-galactosidase complex [GO:0009341] | beta-galactosidase activity [GO:0004565]; carbohydrate binding [GO:0030246] | egu00052:Galactose metabolism;egu00511:Other glycan degradation;egu00600:Sphingolipid metabolism;egu01100:Metabolic pathways; | IPR004199:Beta galactosidase small chain/ domain 5;IPR006101:Glycoside hydrolase; family 2;IPR006102:Glycoside hydrolase; family 2; immunoglobulin-like beta-sandwich;IPR006103:Glycoside hydrolase; family 2; TIM barrel;IPR006104:Glycoside hydrolase; family 2; N-terminal;IPR008979:Galactose-binding domain-like;IPR011013:Galactose mutarotase-like domain;IPR013783:Immunoglobulin-like fold;IPR014718:Glycoside hydrolase-type carbohydrate-binding; subgroup;IPR017853:Glycoside hydrolase; superfamily;IPR023230:Glycoside hydrolase; family 2; conserved site;IPR023933:Glycoside hydrolase; family 2; beta-galactosidase; |
| CNU23_00003365-RA | CNU23_00003365 | maker-COCO01-augustus-gene-36.33-mRNA-1 | XP_038972361 | uncharacterized LOC120104745(LOC120104745) | Phoenix dactylifera | - | - | nucleic acid binding [GO:0003676]; zinc ion binding [GO:0008270] | - | - |
| CNU23_00003366-RA | CNU23_00003366 | maker-COCO01-augustus-gene-36.4-mRNA-1 | XP_010926971 | haloacid dehalogenase-like hydrolase domain-containing protein 3(LOC105049110) | Elaeis guineensis | - | - | hydrolase activity [GO:0016787] | - | IPR006439:HAD-superfamily hydrolase; subfamily IA; variant 1;IPR011949:HAD-superfamily hydrolase; subfamily IA; REG-2-like;IPR023214:HAD-like domain; |
| CNU23_00003367-RA | CNU23_00003367 | maker-COCO01-augustus-gene-36.38-mRNA-1 | XP_010938566 | uncharacterized LOC105057612(LOC105057612) | Elaeis guineensis | - | - | - | - | IPR025322:Protein of unknown function DUF4228; |
| CNU23_00003368-RA | CNU23_00003368 | maker-COCO01-augustus-gene-36.59-mRNA-1 | XP_010914014 | Uncharacterized protein LOC105039527 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003369-RA | CNU23_00003369 | maker-COCO01-augustus-gene-37.4-mRNA-1 | XP_010927034 | Protein IRON-RELATED TRANSCRIPTION FACTOR 2 isoform X2 | Elaeis guineensis var. tenera (Oil palm) | - | - | protein dimerization activity [GO:0046983] | - | IPR011598;IPR036638; |
| CNU23_00003370-RA | CNU23_00003370 | maker-COCO01-augustus-gene-37.62-mRNA-1 | XP_010926977 | ABC transporter G family member 23(LOC105049114) | Elaeis guineensis | - | membrane [GO:0016020] | ABC-type transporter activity [GO:0140359]; ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887] | egu02010:ABC transporters; | IPR003439:ABC transporter-like;IPR003593:AAA+ ATPase domain;IPR013525:ABC-2 type transporter;IPR017871:ABC transporter; conserved site;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003371-RA | CNU23_00003371 | maker-COCO01-augustus-gene-37.0-mRNA-1 | XP_010926978 | uncharacterized LOC105049116(LOC105049116) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR001841:Zinc finger; RING-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR017907:Zinc finger; RING-type; conserved site; |
| CNU23_00003372-RA | CNU23_00003372 | maker-COCO01-augustus-gene-37.1-mRNA-1 | XP_010905454 | potassium channel KOR1(LOC105032653) | Elaeis guineensis | regulation of monoatomic ion transmembrane transport [GO:0034765] | membrane [GO:0016020] | voltage-gated potassium channel activity [GO:0005249] | - | IPR000595:Cyclic nucleotide-binding domain;IPR002110:Ankyrin repeat;IPR003938:Potassium channel; voltage-dependent; EAG/ELK/ERG;IPR005821:Ion transport domain;IPR014710:RmlC-like jelly roll fold;IPR018490:Cyclic nucleotide-binding-like;IPR021789:Potassium channel; plant-type; |
| CNU23_00003373-RA | CNU23_00003373 | maker-COCO01-augustus-gene-37.2-mRNA-1 | XP_019706081 | phosphatidylinositol 4-phosphate 5-kinase 6(LOC105045600) | Elaeis guineensis | - | membrane [GO:0016020] | 1-phosphatidylinositol-4-phosphate 5-kinase activity [GO:0016308]; ATP binding [GO:0005524] | egu00562:Inositol phosphate metabolism;egu01100:Metabolic pathways;egu04070:Phosphatidylinositol signaling system;egu04144:Endocytosis; | IPR002498:Phosphatidylinositol-4-phosphate 5-kinase; core;IPR003409:MORN motif;IPR017163:Phosphatidylinositol-4-phosphate 5-kinase; plant;IPR023610:Phosphatidylinositol-4-phosphate 5-kinase;IPR027484:Phosphatidylinositol-4-phosphate 5-kinase; N-terminal domain; |
| CNU23_00003374-RA | CNU23_00003374 | maker-COCO01-augustus-gene-37.3-mRNA-1 | XP_019702995 | uncharacterized LOC109505169(LOC109505169) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003375-RA | CNU23_00003375 | maker-COCO01-augustus-gene-38.0-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003376-RA | CNU23_00003376 | genemark-COCO01-processed-gene-38.41-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003377-RA | CNU23_00003377 | maker-COCO01-augustus-gene-38.1-mRNA-1 | XP_010926982 | hydroxyproline O-arabinosyltransferase 3-like(LOC105049121) | Elaeis guineensis | - | membrane [GO:0016020] | glycosyltransferase activity [GO:0016757] | egu00514:Other types of O-glycan biosynthesis; | - |
| CNU23_00003378-RA | CNU23_00003378 | maker-COCO01-augustus-gene-38.33-mRNA-1 | XP_029123626 | uncharacterized LOC114914702(LOC114914702) | Elaeis guineensis | - | - | nucleic acid binding [GO:0003676] | - | - |
| CNU23_00003379-RA | CNU23_00003379 | genemark-COCO01-processed-gene-38.57-mRNA-1 | XP_010911097 | uncharacterized LOC105037092(LOC105037092) | Elaeis guineensis | - | - | - | - | IPR005162:Retrotransposon gag protein; |
| CNU23_00003380-RA | CNU23_00003380 | maker-COCO01-augustus-gene-38.16-mRNA-1 | XP_010926983 | aspartyl protease AED3-like(LOC105049122) | Elaeis guineensis | proteolysis [GO:0006508] | - | aspartic-type endopeptidase activity [GO:0004190] | - | IPR001461:Peptidase A1;IPR021109:Aspartic peptidase; |
| CNU23_00003381-RA | CNU23_00003381 | genemark-COCO01-processed-gene-38.97-mRNA-1 | XP_010926985 | non-specific phospholipase C2(LOC105049123) | Elaeis guineensis | - | - | hydrolase activity; acting on ester bonds [GO:0016788] | egu00562:Inositol phosphate metabolism;egu00564:Glycerophospholipid metabolism;egu00565:Ether lipid metabolism;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR007312:Phosphoesterase;IPR017850:Alkaline-phosphatase-like; core domain; |
| CNU23_00003382-RA | CNU23_00003382 | genemark-COCO01-processed-gene-39.45-mRNA-1 | XP_010938554 | ferredoxin-dependent glutamate synthase; chloroplastic(LOC105057601) | Elaeis guineensis | glutamate biosynthetic process [GO:0006537]; glutamine metabolic process [GO:0006541] | - | 3 iron; 4 sulfur cluster binding [GO:0051538]; glutamate synthase activity [GO:0015930]; metal ion binding [GO:0046872] | egu00630:Glyoxylate and dicarboxylate metabolism;egu00910:Nitrogen metabolism; | IPR002489:Glutamate synthase; alpha subunit; C-terminal;IPR002932:Glutamate synthase; central-C;IPR006982:Glutamate synthase; central-N;IPR013785:Aldolase-type TIM barrel;IPR017932:Glutamine amidotransferase type 2 domain; |
| CNU23_00003383-RA | CNU23_00003383 | genemark-COCO01-processed-gene-39.100-mRNA-1 | XP_010938547 | Rho GTPase-activating protein 7 isoform X1 | Elaeis guineensis var. tenera (Oil palm) | signal transduction [GO:0007165] | - | - | - | IPR025757;IPR011993;IPR001849;IPR008936;IPR000198; |
| CNU23_00003384-RA | CNU23_00003384 | genemark-COCO01-processed-gene-39.63-mRNA-1 | XP_019709649 | putative disease resistance protein RGA1(LOC105055279) | Elaeis guineensis | defense response [GO:0006952]; response to other organism [GO:0051707] | - | ADP binding [GO:0043531] | - | IPR001611:Leucine-rich repeat;IPR002182:NB-ARC;IPR003591:Leucine-rich repeat; typical subtype;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003385-RA | CNU23_00003385 | maker-COCO01-augustus-gene-39.143-mRNA-1 | XP_010929260 | Replication protein A 32 kDa subunit B isoform X3 | Elaeis guineensis var. tenera (Oil palm) | DNA recombination [GO:0006310]; DNA repair [GO:0006281]; DNA replication [GO:0006260] | nucleus [GO:0005634] | DNA binding [GO:0003677] | - | IPR012340;IPR040260;IPR014646;IPR014892;IPR036388;IPR036390; |
| CNU23_00003386-RA | CNU23_00003386 | maker-COCO01-augustus-gene-39.144-mRNA-1 | XP_010911202 | anamorsin homolog(LOC105037211) | Elaeis guineensis | iron-sulfur cluster assembly [GO:0016226] | mitochondrial intermembrane space [GO:0005758] | 2 iron; 2 sulfur cluster binding [GO:0051537]; 4 iron; 4 sulfur cluster binding [GO:0051539]; electron transfer activity [GO:0009055]; metal ion binding [GO:0046872]; methyltransferase activity [GO:0008168] | - | IPR007785:Anamorsin;IPR013216:Methyltransferase type 11; |
| CNU23_00003387-RA | CNU23_00003387 | maker-COCO01-augustus-gene-39.145-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003388-RA | CNU23_00003388 | maker-COCO01-augustus-gene-39.43-mRNA-1 | XP_010935521 | UDP-glycosyltransferase 73C5-like(LOC105055417) | Elaeis guineensis | - | - | UDP-glycosyltransferase activity [GO:0008194] | - | IPR002213:UDP-glucuronosyl/UDP-glucosyltransferase; |
| CNU23_00003389-RA | CNU23_00003389 | maker-COCO01-augustus-gene-39.149-mRNA-1 | XP_019709640 | transcription factor bHLH112-like(LOC105055519) | Elaeis guineensis | - | - | protein dimerization activity [GO:0046983] | - | IPR011598:Myc-type; basic helix-loop-helix (bHLH) domain; |
| CNU23_00003390-RA | CNU23_00003390 | maker-COCO01-augustus-gene-39.55-mRNA-1 | XP_010926990 | U-box domain-containing protein 1(LOC105049126) | Elaeis guineensis | - | - | - | - | IPR000225:Armadillo;IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003391-RA | CNU23_00003391 | maker-COCO01-augustus-gene-39.80-mRNA-1 | XP_010926991 | trihelix transcription factor ASIL1(LOC105049127) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003392-RA | CNU23_00003392 | maker-COCO01-augustus-gene-40.2-mRNA-1 | XP_010926995 | protein transport protein SEC31 homolog B(LOC105049131) | Elaeis guineensis | endoplasmic reticulum to Golgi vesicle-mediated transport [GO:0006888] | endoplasmic reticulum [GO:0005783] | - | egu04141:Protein processing in endoplasmic reticulum; | IPR001680:WD40 repeat;IPR015943:WD40/YVTN repeat-like-containing domain; |
| CNU23_00003393-RA | CNU23_00003393 | maker-COCO01-augustus-gene-39.58-mRNA-1 | XP_010936963 | 40S ribosomal protein S3-3(LOC105056456) | Elaeis guineensis | translation [GO:0006412] | cytoplasm [GO:0005737]; small ribosomal subunit [GO:0015935] | RNA binding [GO:0003723]; structural constituent of ribosome [GO:0003735] | egu03010:Ribosome; | IPR001351:Ribosomal protein S3; C-terminal;IPR004044:K Homology domain; type 2;IPR005703:Ribosomal protein S3; eukaryotic/archaeal;IPR009019:K homology domain; prokaryotic type;IPR015946:K homology domain-like; alpha/beta;IPR018280:Ribosomal protein S3; conserved site; |
| CNU23_00003394-RA | CNU23_00003394 | maker-COCO01-augustus-gene-40.40-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003395-RA | CNU23_00003395 | maker-COCO01-augustus-gene-40.28-mRNA-1 | XP_010922211 | beta-1;2-xylosyltransferase XYXT1(LOC105045572) | Elaeis guineensis | - | Golgi membrane [GO:0000139] | pentosyltransferase activity [GO:0016763] | - | IPR007657:Glycosyltransferase AER61; uncharacterised; |
| CNU23_00003396-RA | CNU23_00003396 | maker-COCO01-augustus-gene-40.3-mRNA-1 | XP_010926997 | beta-1;2-xylosyltransferase XYXT1(LOC105049132) | Elaeis guineensis | - | Golgi membrane [GO:0000139] | pentosyltransferase activity [GO:0016763] | - | IPR007657:Glycosyltransferase AER61; uncharacterised; |
| CNU23_00003397-RA | CNU23_00003397 | genemark-COCO01-processed-gene-40.17-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_000003404-RA | CNU23_000003404 | maker-COCO01-augustus-gene-40.1-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003398-RA | CNU23_00003398 | genemark-COCO01-processed-gene-40.52-mRNA-1 | XP_019707218 | kinesin-like protein KIN-14A(LOC105049169) | Elaeis guineensis | microtubule-based movement [GO:0007018] | microtubule [GO:0005874] | ATP binding [GO:0005524]; microtubule binding [GO:0008017]; microtubule motor activity [GO:0003777] | egu04814:Motor proteins; | IPR001715:Calponin homology domain;IPR001752:Kinesin; motor domain;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003399-RA | CNU23_00003399 | maker-COCO01-augustus-gene-40.5-mRNA-1 | XP_019707218 | kinesin-like protein KIN-14A(LOC105049169) | Elaeis guineensis | microtubule-based movement [GO:0007018] | microtubule [GO:0005874] | ATP binding [GO:0005524]; microtubule binding [GO:0008017]; microtubule motor activity [GO:0003777] | egu04814:Motor proteins; | IPR001715:Calponin homology domain;IPR001752:Kinesin; motor domain;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003400-RA | CNU23_00003400 | genemark-COCO01-processed-gene-40.62-mRNA-1 | XP_010926998 | uncharacterized LOC105049133(LOC105049133) | Elaeis guineensis | DNA repair [GO:0006281] | - | catalytic activity [GO:0003824] | - | IPR011257:DNA glycosylase; |
| CNU23_00003401-RA | CNU23_00003401 | maker-COCO01-augustus-gene-40.7-mRNA-1 | XP_010926999 | serine/threonine-protein kinase-like protein At3g51990(LOC105049134) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein kinase activity [GO:0004672] | - | IPR000719:Protein kinase; catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site; |
| CNU23_00003402-RA | CNU23_00003402 | maker-COCO01-augustus-gene-40.0-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003403-RA | CNU23_00003403 | maker-COCO01-augustus-gene-40.37-mRNA-1 | XP_010915256 | pathogen-associated molecular patterns-induced protein A70(LOC105040435) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR008480:Protein of unknown function DUF761; plant;IPR025520:Domain of unknown function DUF4408; |
| CNU23_00003404-RA | CNU23_00003404 | maker-COCO01-augustus-gene-40.1-mRNA-1 | XP_010927004 | 50S ribosomal protein L1; chloroplastic | Elaeis guineensis var. tenera (Oil palm) | translation [GO:0006412] | large ribosomal subunit [GO:0015934] | rRNA binding [GO:0019843]; structural constituent of ribosome [GO:0003735] | egu03010:Ribosome; | IPR005878;IPR023674;IPR028364;IPR016095;IPR023673; |
| CNU23_00003405-RA | CNU23_00003405 | maker-COCO01-augustus-gene-41.62-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003407-RA | CNU23_00003407 | maker-COCO01-augustus-gene-41.121-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003406-RA | CNU23_00003406 | maker-COCO01-augustus-gene-41.4-mRNA-1 | XP_010927007 | T-complex protein 1 subunit epsilon(LOC105049140) | Elaeis guineensis | GO:0006457~protein folding; | GO:0005829~cytosol; | GO:0005524~ATP binding;GO:0016887~ATPase activity;GO:0051082~unfolded protein binding; | - | IPR002194:Chaperonin TCP-1; conserved site;IPR002423:Chaperonin Cpn60/TCP-1;IPR012718:T-complex protein 1; epsilon subunit;IPR017998:Chaperone tailless complex polypeptide 1 (TCP-1);IPR027409:GroEL-like apical domain;IPR027410:TCP-1-like chaperonin intermediate domain;IPR027413:GroEL-like equatorial domain; |
| CNU23_00003408-RA | CNU23_00003408 | maker-COCO01-augustus-gene-41.122-mRNA-1 | XP_010927011 | RRP12-like protein(LOC105049143) | Elaeis guineensis | - | nucleus [GO:0005634] | - | - | IPR011989:Armadillo-like helical;IPR012978:Uncharacterised domain NUC173;IPR016024:Armadillo-type fold; |
| CNU23_00003409-RA | CNU23_00003409 | genemark-COCO01-processed-gene-41.79-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003410-RA | CNU23_00003410 | genemark-COCO01-processed-gene-42.11-mRNA-1 | XP_010927015 | DNA repair protein RAD50(LOC105049145) | Elaeis guineensis | double-strand break repair [GO:0006302]; telomere maintenance [GO:0000723] | Mre11 complex [GO:0030870] | ATP binding [GO:0005524]; ATP hydrolysis activity [GO:0016887]; metal ion binding [GO:0046872] | egu03440:Homologous recombination;egu03450:Non-homologous end-joining; | IPR004584:DNA repair protein Rad50;IPR013134:Zinc hook; Rad50;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003411-RA | CNU23_00003411 | genemark-COCO01-processed-gene-42.47-mRNA-1 | XP_010927017 | CTL-like protein DDB_G0274487(LOC105049146) | Elaeis guineensis | - | plasma membrane [GO:0005886] | transmembrane transporter activity [GO:0022857] | - | IPR007603:Choline transporter-like; |
| CNU23_00003412-RA | CNU23_00003412 | maker-COCO01-augustus-gene-42.115-mRNA-1 | XP_010927019 | microtubule-binding protein TANGLED1(LOC105049149) | Elaeis guineensis | regulation of phragmoplast microtubule organization [GO:2000694] | - | microtubule binding [GO:0008017] | - | - |
| CNU23_00003413-RA | CNU23_00003413 | maker-COCO01-augustus-gene-42.113-mRNA-1 | XP_010927023 | probable transmembrane GTPase FZO-like; chloroplastic(LOC105049151) | Elaeis guineensis | - | - | GTP binding [GO:0005525] | - | IPR005225:Small GTP-binding protein domain;IPR006073:GTP binding domain;IPR013785:Aldolase-type TIM barrel;IPR022998:Thiamin phosphate synthase superfamily;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003414-RA | CNU23_00003414 | maker-COCO01-augustus-gene-42.25-mRNA-1 | XP_010927044 | protein FANTASTIC FOUR 3-like(LOC105049173) | Elaeis guineensis | - | - | - | - | IPR021410:Protein of unknown function DUF3049; |
| CNU23_000003423-RA | CNU23_000003423 | maker-COCO01-augustus-gene-43.4-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003415-RA | CNU23_00003415 | maker-COCO01-augustus-gene-43.35-mRNA-1 | XP_010942035 | probable inactive patatin-like protein 9(LOC105060117) | Elaeis guineensis | lipid catabolic process [GO:0016042] | - | lipase activity [GO:0016298] | - | IPR002641:Patatin/Phospholipase A2-related;IPR016035:Acyl transferase/acyl hydrolase/lysophospholipase; |
| CNU23_00003416-RA | CNU23_00003416 | maker-COCO01-augustus-gene-43.44-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003417-RA | CNU23_00003417 | genemark-COCO01-processed-gene-43.70-mRNA-1 | XP_010942034 | probable glycosyltransferase STELLO1(LOC105060115) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR005049:Protein of unknown function DUF288; |
| CNU23_00003418-RA | CNU23_00003418 | maker-COCO01-augustus-gene-43.18-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003419-RA | CNU23_00003419 | genemark-COCO01-processed-gene-43.79-mRNA-1 | XP_010942033 | E3 ubiquitin-protein ligase KEG(LOC105060114) | Elaeis guineensis | abscisic acid-activated signaling pathway [GO:0009738]; defense response [GO:0006952]; protein phosphorylation [GO:0006468]; protein ubiquitination [GO:0016567] | - | ATP binding [GO:0005524]; metal ion binding [GO:0046872]; protein kinase activity [GO:0004672]; ubiquitin-protein transferase activity [GO:0004842] | - | IPR000719:Protein kinase; catalytic domain;IPR001841:Zinc finger; RING-type;IPR002110:Ankyrin repeat;IPR011009:Protein kinase-like domain;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR017907:Zinc finger; RING-type; conserved site;IPR027370:RING-type zinc-finger; LisH dimerisation motif; |
| CNU23_00003420-RA | CNU23_00003420 | maker-COCO01-augustus-gene-43.6-mRNA-1 | XP_030945947 | uncharacterized LOC115970454(LOC115970454) | Quercus lobata | - | - | - | - | - |
| CNU23_00003421-RA | CNU23_00003421 | genemark-COCO01-processed-gene-43.81-mRNA-1 | XP_010942033 | E3 ubiquitin-protein ligase KEG(LOC105060114) | Elaeis guineensis | abscisic acid-activated signaling pathway [GO:0009738]; defense response [GO:0006952]; protein phosphorylation [GO:0006468]; protein ubiquitination [GO:0016567] | - | ATP binding [GO:0005524]; metal ion binding [GO:0046872]; protein kinase activity [GO:0004672]; ubiquitin-protein transferase activity [GO:0004842] | - | IPR000719:Protein kinase; catalytic domain;IPR001841:Zinc finger; RING-type;IPR002110:Ankyrin repeat;IPR011009:Protein kinase-like domain;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR017907:Zinc finger; RING-type; conserved site;IPR027370:RING-type zinc-finger; LisH dimerisation motif; |
| CNU23_00003422-RA | CNU23_00003422 | maker-COCO01-augustus-gene-43.57-mRNA-1 | XP_038971146 | uncharacterized LOC120104296(LOC120104296) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003423-RA | CNU23_00003423 | maker-COCO01-augustus-gene-43.4-mRNA-1 | XP_029117042 | EEF1A lysine methyltransferase 4 | Elaeis guineensis var. tenera (Oil palm) | methylation [GO:0032259] | - | methyltransferase activity [GO:0008168] | - | IPR013216;IPR029063; |
| CNU23_00003424-RA | CNU23_00003424 | maker-COCO01-augustus-gene-43.5-mRNA-1 | XP_010906017 | serine carboxypeptidase II-3(LOC105033064) | Elaeis guineensis | proteolysis [GO:0006508] | - | serine-type carboxypeptidase activity [GO:0004185] | - | IPR001563:Peptidase S10; serine carboxypeptidase;IPR018202:Peptidase S10; serine carboxypeptidase; active site; |
| CNU23_00003425-RA | CNU23_00003425 | augustus-COCO01-processed-gene-44.4-mRNA-1 | XP_010927268 | choline monooxygenase; chloroplastic(LOC105049342) | Elaeis guineensis | glycine betaine biosynthetic process from choline [GO:0019285] | chloroplast stroma [GO:0009570] | 2 iron; 2 sulfur cluster binding [GO:0051537]; choline monooxygenase activity [GO:0019133]; iron ion binding [GO:0005506] | egu00260:Glycine; serine and threonine metabolism;egu01100:Metabolic pathways; | IPR001663:Aromatic-ring-hydroxylating dioxygenase; alpha subunit;IPR015879:Aromatic-ring-hydroxylating dioxygenase; alpha subunit; C-terminal domain;IPR017941:Rieske [2Fe-2S] iron-sulphur domain; |
| CNU23_00003426-RA | CNU23_00003426 | augustus-COCO01-processed-gene-44.8-mRNA-1 | XP_010927268 | choline monooxygenase; chloroplastic(LOC105049342) | Elaeis guineensis | glycine betaine biosynthetic process from choline [GO:0019285] | chloroplast stroma [GO:0009570] | 2 iron; 2 sulfur cluster binding [GO:0051537]; choline monooxygenase activity [GO:0019133]; iron ion binding [GO:0005506] | egu00260:Glycine; serine and threonine metabolism;egu01100:Metabolic pathways; | IPR001663:Aromatic-ring-hydroxylating dioxygenase; alpha subunit;IPR015879:Aromatic-ring-hydroxylating dioxygenase; alpha subunit; C-terminal domain;IPR017941:Rieske [2Fe-2S] iron-sulphur domain; |
| CNU23_00003427-RA | CNU23_00003427 | maker-COCO01-augustus-gene-44.119-mRNA-1 | XP_029117043 | serine carboxypeptidase II-3(LOC105033062) | Elaeis guineensis | proteolysis [GO:0006508] | - | serine-type carboxypeptidase activity [GO:0004185] | - | - |
| CNU23_00003428-RA | CNU23_00003428 | genemark-COCO01-processed-gene-44.90-mRNA-1 | XP_010906015 | uncharacterized LOC105033061(LOC105033061) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003429-RA | CNU23_00003429 | maker-COCO01-augustus-gene-44.124-mRNA-1 | XP_010906014 | uncharacterized LOC105033060(LOC105033060) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003430-RA | CNU23_00003430 | genemark-COCO01-processed-gene-44.94-mRNA-1 | XP_010906015 | uncharacterized LOC105033061(LOC105033061) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003431-RA | CNU23_00003431 | maker-COCO01-augustus-gene-44.126-mRNA-1 | XP_010906014 | uncharacterized LOC105033060(LOC105033060) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003432-RA | CNU23_00003432 | maker-COCO01-augustus-gene-44.120-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003433-RA | CNU23_00003433 | genemark-COCO01-processed-gene-44.87-mRNA-1 | XP_010911302 | uncharacterized LOC105037321(LOC105037321) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003434-RA | CNU23_00003434 | maker-COCO01-augustus-gene-45.104-mRNA-1 | XP_010905244 | BTB/POZ and MATH domain-containing protein 1(LOC105032488) | Elaeis guineensis | cellular response to salt stress [GO:0071472]; protein ubiquitination [GO:0016567] | - | - | - | IPR000210:BTB/POZ-like;IPR002083:MATH;IPR008974:TRAF-like;IPR011333:BTB/POZ fold; |
| CNU23_00003435-RA | CNU23_00003435 | maker-COCO01-augustus-gene-45.105-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003436-RA | CNU23_00003436 | maker-COCO01-augustus-gene-45.32-mRNA-1 | XP_010905247 | uncharacterized protein At5g19025(LOC105032491) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003437-RA | CNU23_00003437 | maker-COCO01-augustus-gene-46.30-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003438-RA | CNU23_00003438 | genemark-COCO01-processed-gene-46.61-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003439-RA | CNU23_00003439 | maker-COCO01-augustus-gene-46.141-mRNA-1 | XP_010907974 | CSC1-like protein ERD4(LOC105034485) | Elaeis guineensis | - | membrane [GO:0016020] | calcium activated cation channel activity [GO:0005227] | - | IPR003864:Domain of unknown function DUF221; |
| CNU23_00003440-RA | CNU23_00003440 | maker-COCO01-augustus-gene-46.39-mRNA-1 | XP_010905249 | EID1-like F-box protein 3(LOC105032493) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003441-RA | CNU23_00003441 | maker-COCO01-augustus-gene-46.44-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003442-RA | CNU23_00003442 | maker-COCO01-augustus-gene-46.50-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003443-RA | CNU23_00003443 | maker-COCO01-augustus-gene-46.48-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003444-RA | CNU23_00003444 | maker-COCO01-augustus-gene-46.45-mRNA-1 | XP_010905250 | uncharacterized LOC105032494(LOC105032494) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003445-RA | CNU23_00003445 | maker-COCO01-augustus-gene-47.102-mRNA-1 | XP_010905251 | protein HUA2-LIKE 2(LOC105032495) | Elaeis guineensis | mRNA processing [GO:0006397] | - | - | - | IPR000313:PWWP;IPR006569:CID domain;IPR008942:ENTH/VHS; |
| CNU23_00003446-RA | CNU23_00003446 | maker-COCO01-augustus-gene-47.103-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003447-RA | CNU23_00003447 | maker-COCO01-augustus-gene-47.101-mRNA-1 | XP_019701327 | nitrate regulatory gene2 protein(LOC105060463) | Elaeis guineensis | - | - | - | - | IPR006867:Domain of unknown function DUF632;IPR006868:Domain of unknown function DUF630; |
| CNU23_00003448-RA | CNU23_00003448 | genemark-COCO01-processed-gene-47.39-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003449-RA | CNU23_00003449 | maker-COCO01-augustus-gene-47.36-mRNA-1 | XP_010942304 | rust resistance kinase Lr10(LOC105060339) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; polysaccharide binding [GO:0030247]; protein kinase activity [GO:0004672] | - | IPR000719:Protein kinase; catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site;IPR025287:Wall-associated receptor kinase galacturonan-binding domain; |
| CNU23_00003450-RA | CNU23_00003450 | augustus-COCO01-processed-gene-47.100-mRNA-1 | XP_019701302 | LEAF RUST 10 DISEASE-RESISTANCE LOCUS RECEPTOR-LIKE PROTEIN KINASE-like 2.1(LOC105060343) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; polysaccharide binding [GO:0030247]; protein kinase activity [GO:0004672] | - | IPR000719:Protein kinase; catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site;IPR025287:Wall-associated receptor kinase galacturonan-binding domain; |
| CNU23_00003451-RA | CNU23_00003451 | augustus-COCO01-processed-gene-48.106-mRNA-1 | XP_019701302 | LEAF RUST 10 DISEASE-RESISTANCE LOCUS RECEPTOR-LIKE PROTEIN KINASE-like 2.1(LOC105060343) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; polysaccharide binding [GO:0030247]; protein kinase activity [GO:0004672] | - | IPR000719:Protein kinase; catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site;IPR025287:Wall-associated receptor kinase galacturonan-binding domain; |
| CNU23_00003452-RA | CNU23_00003452 | maker-COCO01-augustus-gene-49.0-mRNA-1 | XP_037441816 | uncharacterized LOC119310070(LOC119310070) | Triticum dicoccoides | - | - | - | - | - |
| CNU23_00003453-RA | CNU23_00003453 | genemark-COCO01-processed-gene-49.39-mRNA-1 | XP_010942483 | uncharacterized LOC105060462(LOC105060462) | Elaeis guineensis | - | - | ubiquitin binding [GO:0043130] | - | IPR003892:Ubiquitin system component Cue;IPR009060:UBA-like; |
| CNU23_00003454-RA | CNU23_00003454 | maker-COCO01-augustus-gene-49.42-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003455-RA | CNU23_00003455 | maker-COCO01-augustus-gene-49.14-mRNA-1 | XP_037441816 | uncharacterized LOC119310070(LOC119310070) | Triticum dicoccoides | - | - | - | - | - |
| CNU23_00003456-RA | CNU23_00003456 | genemark-COCO01-processed-gene-49.77-mRNA-1 | XP_010942483 | uncharacterized LOC105060462(LOC105060462) | Elaeis guineensis | - | - | ubiquitin binding [GO:0043130] | - | IPR003892:Ubiquitin system component Cue;IPR009060:UBA-like; |
| CNU23_00003457-RA | CNU23_00003457 | maker-COCO01-augustus-gene-49.51-mRNA-1 | XP_010943144 | ruvB-like 2(LOC105060951) | Elaeis guineensis | - | nucleus [GO:0005634] | ATP binding [GO:0005524]; ATP-dependent activity; acting on DNA [GO:0008094]; helicase activity [GO:0004386]; hydrolase activity [GO:0016787] | - | IPR003593:AAA+ ATPase domain;IPR010339:TIP49; C-terminal;IPR027238:RuvB-like;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003458-RA | CNU23_00003458 | genemark-COCO01-processed-gene-50.8-mRNA-1 | XP_010906482 | E3 ubiquitin-protein ligase HOS1(LOC105033404) | Elaeis guineensis | protein ubiquitination [GO:0016567] | nucleus [GO:0005634] | ubiquitin-protein transferase activity [GO:0004842] | - | IPR001841:Zinc finger; RING-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR025151:ELYS-like domain; |
| CNU23_00003459-RA | CNU23_00003459 | maker-COCO01-augustus-gene-50.17-mRNA-1 | XP_010942492 | uncharacterized LOC105060474(LOC105060474) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003460-RA | CNU23_00003460 | genemark-COCO01-processed-gene-50.33-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003461-RA | CNU23_00003461 | maker-COCO01-augustus-gene-50.19-mRNA-1 | XP_010942491 | adenylate isopentenyltransferase 5; chloroplastic-like(LOC105060472) | Elaeis guineensis | cytokinin biosynthetic process [GO:0009691] | - | - | egu00908:Zeatin biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003462-RA | CNU23_00003462 | maker-COCO01-augustus-gene-50.10-mRNA-1 | XP_010942491 | adenylate isopentenyltransferase 5; chloroplastic-like(LOC105060472) | Elaeis guineensis | cytokinin biosynthetic process [GO:0009691] | - | - | egu00908:Zeatin biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003463-RA | CNU23_00003463 | maker-COCO01-augustus-gene-50.90-mRNA-1 | XP_010942479 | TVP38/TMEM64 family membrane protein slr0305(LOC105060458) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR015414:SNARE associated Golgi protein; |
| CNU23_00003464-RA | CNU23_00003464 | augustus-COCO01-processed-gene-50.84-mRNA-1 | XP_010942480 | pentatricopeptide repeat-containing protein At2g30780(LOC105060460) | Elaeis guineensis | - | - | mRNA binding [GO:0003729] | - | IPR002885:Pentatricopeptide repeat;IPR011990:Tetratricopeptide-like helical; |
| CNU23_00003465-RA | CNU23_00003465 | maker-COCO01-augustus-gene-50.15-mRNA-1 | XP_010930237 | uncharacterized LOC105051469(LOC105051469) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003466-RA | CNU23_00003466 | maker-COCO01-augustus-gene-50.91-mRNA-1 | XP_010942478 | exocyst complex component SEC8(LOC105060457) | Elaeis guineensis | Golgi to plasma membrane transport [GO:0006893]; protein targeting to membrane [GO:0006612]; vesicle docking involved in exocytosis [GO:0006904]; vesicle tethering involved in exocytosis [GO:0090522] | exocyst [GO:0000145] | - | - | IPR007191:Sec8 exocyst complex component specific domain; |
| CNU23_00003467-RA | CNU23_00003467 | genemark-COCO01-processed-gene-51.17-mRNA-1 | XP_010942475 | uncharacterized isomerase BH0283(LOC105060455) | Elaeis guineensis | biosynthetic process [GO:0009058] | - | catalytic activity [GO:0003824] | - | IPR003719:Phenazine biosynthesis PhzF protein; |
| CNU23_00003468-RA | CNU23_00003468 | genemark-COCO01-processed-gene-51.16-mRNA-1 | XP_010942470 | probable E3 ubiquitin-protein ligase LUL4(LOC105060452) | Elaeis guineensis | - | - | metal ion binding [GO:0046872]; ubiquitin protein ligase activity [GO:0061630] | - | IPR001841:Zinc finger; RING-type;IPR013083:Zinc finger; RING/FYVE/PHD-type; |
| CNU23_00003469-RA | CNU23_00003469 | maker-COCO01-augustus-gene-51.21-mRNA-1 | XP_010942489 | heavy metal-associated isoprenylated plant protein 33(LOC105060470) | Elaeis guineensis | - | - | metal ion binding [GO:0046872] | - | IPR006121:Heavy metal-associated domain; HMA; |
| CNU23_00003470-RA | CNU23_00003470 | genemark-COCO01-processed-gene-51.90-mRNA-1 | XP_008775126 | uncharacterized LOC103695542(LOC103695542) | Phoenix dactylifera | - | - | DNA binding [GO:0003677] | - | - |
| CNU23_00003471-RA | CNU23_00003471 | maker-COCO01-augustus-gene-51.2-mRNA-1 | XP_010942469 | RNA-binding protein Y14A isoform X4 | Elaeis guineensis var. tenera (Oil palm) | RNA processing [GO:0006396] | cytoplasm [GO:0005737]; nucleus [GO:0005634] | mRNA binding [GO:0003729] | - | IPR012677;IPR035979;IPR008111;IPR000504;IPR033744; |
| CNU23_00003472-RA | CNU23_00003472 | maker-COCO01-augustus-gene-51.6-mRNA-1 | XP_010942467 | SUMO-activating enzyme subunit 2(LOC105060449) | Elaeis guineensis | protein sumoylation [GO:0016925] | SUMO activating enzyme complex [GO:0031510] | ATP binding [GO:0005524]; metal ion binding [GO:0046872]; SUMO activating enzyme activity [GO:0019948] | egu04120:Ubiquitin mediated proteolysis; | IPR000594:UBA/THIF-type NAD/FAD binding fold;IPR019572:Ubiquitin-activating enzyme;IPR023318:Ubiquitin activating enzyme; alpha domain; |
| CNU23_00003473-RA | CNU23_00003473 | maker-COCO01-augustus-gene-51.3-mRNA-1 | XP_019708331 | protein trichome birefringence-like 8(LOC105052140) | Elaeis guineensis | xylan acetylation [GO:1990937] | Golgi membrane [GO:0000139] | xylan O-acetyltransferase activity [GO:1990538] | - | IPR025846:PMR5 N-terminal domain;IPR026057:PC-Esterase; |
| CNU23_00003474-RA | CNU23_00003474 | maker-COCO01-augustus-gene-51.51-mRNA-1 | XP_017699572 | uncharacterized LOC108511492(LOC108511492) | Phoenix dactylifera | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003475-RA | CNU23_00003475 | genemark-COCO01-processed-gene-52.12-mRNA-1 | XP_010942465 | NEDD8-activating enzyme E1 catalytic subunit(LOC105060447) | Elaeis guineensis | protein neddylation [GO:0045116] | - | ATP binding [GO:0005524]; NEDD8 activating enzyme activity [GO:0019781] | egu04120:Ubiquitin mediated proteolysis; | IPR000594:UBA/THIF-type NAD/FAD binding fold;IPR014929:E2 binding;IPR023318:Ubiquitin activating enzyme; alpha domain; |
| CNU23_00003476-RA | CNU23_00003476 | genemark-COCO01-processed-gene-52.18-mRNA-1 | XP_010942464 | uncharacterized LOC105060446(LOC105060446) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003477-RA | CNU23_00003477 | maker-COCO01-augustus-gene-52.17-mRNA-1 | XP_010906131 | probable methyltransferase PMT5(LOC105033151) | Elaeis guineensis | methylation [GO:0032259] | membrane [GO:0016020] | methyltransferase activity [GO:0008168] | - | IPR004159:Putative S-adenosyl-L-methionine-dependent methyltransferase; |
| CNU23_00003478-RA | CNU23_00003478 | genemark-COCO01-processed-gene-52.61-mRNA-1 | XP_010915175 | aminopeptidase M1(LOC105040383) | Elaeis guineensis | proteolysis [GO:0006508] | intracellular membrane-bounded organelle [GO:0043231]; membrane [GO:0016020] | aminopeptidase activity [GO:0004177]; metallopeptidase activity [GO:0008237]; zinc ion binding [GO:0008270] | - | IPR001930:Peptidase M1; alanine aminopeptidase/leukotriene A4 hydrolase;IPR014782:Peptidase M1; membrane alanine aminopeptidase; N-terminal;IPR024571:Domain of unknown function DUF3358; |
| CNU23_00003479-RA | CNU23_00003479 | genemark-COCO01-processed-gene-52.65-mRNA-1 | XP_010916728 | protein PLASTID MOVEMENT IMPAIRED 1-RELATED 1-like(LOC105041452) | Elaeis guineensis | - | - | - | - | IPR018392:Peptidoglycan-binding lysin domain;IPR019448:EEIG1/EHBP1 N-terminal domain; |
| CNU23_00003480-RA | CNU23_00003480 | genemark-COCO01-processed-gene-52.77-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003481-RA | CNU23_00003481 | genemark-COCO01-processed-gene-53.72-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003482-RA | CNU23_00003482 | maker-COCO01-augustus-gene-53.147-mRNA-1 | XP_010942444 | DNA ligase 1(LOC105060442) | Elaeis guineensis | DNA biosynthetic process [GO:0071897]; DNA recombination [GO:0006310]; DNA repair [GO:0006281]; DNA replication [GO:0006260] | - | ATP binding [GO:0005524]; DNA binding [GO:0003677]; DNA ligase (ATP) activity [GO:0003910] | egu03030:DNA replication;egu03410:Base excision repair;egu03420:Nucleotide excision repair;egu03430:Mismatch repair; | IPR000977:DNA ligase; ATP-dependent;IPR012308:DNA ligase; ATP-dependent; N-terminal;IPR012309:DNA ligase; ATP-dependent; C-terminal;IPR012310:DNA ligase; ATP-dependent; central;IPR012340:Nucleic acid-binding; OB-fold;IPR016059:DNA ligase; ATP-dependent; conserved site; |
| CNU23_00003483-RA | CNU23_00003483 | maker-COCO01-augustus-gene-53.150-mRNA-1 | XP_010942436 | DNA repair protein UVH3(LOC105060440) | Elaeis guineensis | nucleotide-excision repair [GO:0006289] | nucleus [GO:0005634] | endonuclease activity [GO:0004519]; metal ion binding [GO:0046872]; single-stranded DNA binding [GO:0003697] | egu03420:Nucleotide excision repair; | IPR001044:XPG/Rad2 endonuclease; eukaryotes;IPR006084:XPG/Rad2 endonuclease;IPR006085:XPG N-terminal;IPR006086:XPG-I domain;IPR008918:Helix-hairpin-helix motif; class 2;IPR019974:XPG conserved site; |
| CNU23_00003484-RA | CNU23_00003484 | maker-COCO01-augustus-gene-54.102-mRNA-1 | XP_010942434 | cyclin-dependent kinase D-1(LOC105060439) | Elaeis guineensis | protein phosphorylation [GO:0006468] | transcription factor TFIIK complex [GO:0070985] | ATP binding [GO:0005524]; RNA polymerase II CTD heptapeptide repeat kinase activity [GO:0008353] | egu03022:Basal transcription factors;egu03420:Nucleotide excision repair; | IPR000719:Protein kinase; catalytic domain;IPR008271:Serine/threonine-protein kinase; active site;IPR011009:Protein kinase-like domain;IPR017441:Protein kinase; ATP binding site; |
| CNU23_00003485-RA | CNU23_00003485 | maker-COCO01-augustus-gene-54.3-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003486-RA | CNU23_00003486 | maker-COCO01-augustus-gene-54.103-mRNA-1 | XP_010942433 | ARM REPEAT PROTEIN INTERACTING WITH ABF2(LOC105060438) | Elaeis guineensis | - | - | - | - | IPR000210:BTB/POZ-like;IPR000225:Armadillo;IPR011333:BTB/POZ fold;IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003487-RA | CNU23_00003487 | genemark-COCO01-processed-gene-54.35-mRNA-1 | XP_010942433 | ARM REPEAT PROTEIN INTERACTING WITH ABF2(LOC105060438) | Elaeis guineensis | - | - | - | - | IPR000210:BTB/POZ-like;IPR000225:Armadillo;IPR011333:BTB/POZ fold;IPR011989:Armadillo-like helical;IPR016024:Armadillo-type fold; |
| CNU23_00003488-RA | CNU23_00003488 | genemark-COCO01-processed-gene-54.66-mRNA-1 | XP_010942486 | uncharacterized LOC105060465(LOC105060465) | Elaeis guineensis | - | nucleus [GO:0005634] | - | - | IPR005491:EMSY N-terminal;IPR008395:Agenet-like domain;IPR014002:Tudor-like; plant; |
| CNU23_00003489-RA | CNU23_00003489 | genemark-COCO01-processed-gene-54.74-mRNA-1 | XP_010942432 | UPF0603 protein Os05g0401100; chloroplastic(LOC105060437) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR007621:TPM domain; |
| CNU23_00003490-RA | CNU23_00003490 | maker-COCO01-augustus-gene-54.105-mRNA-1 | XP_008797056 | uncharacterized LOC103712340(LOC103712340) | Phoenix dactylifera | photosynthesis [GO:0015979] | extrinsic component of membrane [GO:0019898]; photosystem II oxygen evolving complex [GO:0009654] | calcium ion binding [GO:0005509] | - | - |
| CNU23_00003491-RA | CNU23_00003491 | genemark-COCO01-processed-gene-55.39-mRNA-1 | XP_010942432 | UPF0603 protein Os05g0401100; chloroplastic(LOC105060437) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR007621:TPM domain; |
| CNU23_00003492-RA | CNU23_00003492 | maker-COCO01-augustus-gene-55.97-mRNA-1 | XP_008797056 | uncharacterized LOC103712340(LOC103712340) | Phoenix dactylifera | photosynthesis [GO:0015979] | extrinsic component of membrane [GO:0019898]; photosystem II oxygen evolving complex [GO:0009654] | calcium ion binding [GO:0005509] | - | - |
| CNU23_00003493-RA | CNU23_00003493 | maker-COCO01-augustus-gene-55.5-mRNA-1 | XP_010942428 | uncharacterized LOC105060435(LOC105060435) | Elaeis guineensis | - | - | - | - | IPR022742:Alpha/beta hydrolase; N-terminal; |
| CNU23_00003494-RA | CNU23_00003494 | maker-COCO01-augustus-gene-56.0-mRNA-1 | XP_010942427 | kinesin-like protein KIN-14J(LOC105060433) | Elaeis guineensis | microtubule-based movement [GO:0007018] | microtubule [GO:0005874] | ATP binding [GO:0005524]; microtubule binding [GO:0008017]; microtubule motor activity [GO:0003777] | egu04814:Motor proteins; | IPR001752:Kinesin; motor domain;IPR019821:Kinesin; motor region; conserved site;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003495-RA | CNU23_00003495 | maker-COCO01-augustus-gene-56.2-mRNA-1 | XP_010942425 | peroxisomal adenine nucleotide carrier 1(LOC105060431) | Elaeis guineensis | fatty acid beta-oxidation [GO:0006635] | peroxisomal membrane [GO:0005778] | ADP transmembrane transporter activity [GO:0015217]; ATP transmembrane transporter activity [GO:0005347] | - | IPR018108:Mitochondrial substrate/solute carrier;IPR023395:Mitochondrial carrier domain; |
| CNU23_00003496-RA | CNU23_00003496 | genemark-COCO01-processed-gene-56.25-mRNA-1 | XP_010942424 | leucine-rich repeat receptor-like serine/threonine-protein kinase At2g14510(LOC105060430) | Elaeis guineensis | phosphorylation [GO:0016310] | - | kinase activity [GO:0016301] | - | IPR013210:Leucine-rich repeat-containing N-terminal; type 2;IPR024788:Malectin-like carbohydrate-binding domain; |
| CNU23_00003497-RA | CNU23_00003497 | genemark-COCO01-processed-gene-56.26-mRNA-1 | XP_010942424 | leucine-rich repeat receptor-like serine/threonine-protein kinase At2g14510(LOC105060430) | Elaeis guineensis | phosphorylation [GO:0016310] | - | kinase activity [GO:0016301] | - | IPR013210:Leucine-rich repeat-containing N-terminal; type 2;IPR024788:Malectin-like carbohydrate-binding domain; |
| CNU23_00003498-RA | CNU23_00003498 | maker-COCO01-augustus-gene-57.1-mRNA-1 | XP_010942417 | branched-chain-amino-acid aminotransferase-like protein 2(LOC105060429) | Elaeis guineensis | - | - | transaminase activity [GO:0008483] | - | IPR001544:Aminotransferase; class IV;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003499-RA | CNU23_00003499 | maker-COCO01-augustus-gene-57.7-mRNA-1 | XP_010942413 | protein ABCI12; chloroplastic(LOC105060427) | Elaeis guineensis | - | plasma membrane [GO:0005886] | - | - | IPR003339:ABC/ECF transporter; transmembrane component; |
| CNU23_00003500-RA | CNU23_00003500 | maker-COCO01-augustus-gene-57.2-mRNA-1 | XP_010942411 | DEAD-box ATP-dependent RNA helicase 57(LOC105060426) | Elaeis guineensis | maturation of SSU-rRNA [GO:0030490] | - | ATP binding [GO:0005524]; hydrolase activity [GO:0016787]; RNA binding [GO:0003723]; RNA helicase activity [GO:0003724] | - | IPR001650:Helicase; C-terminal;IPR011545:DNA/RNA helicase; DEAD/DEAH box type; N-terminal;IPR014001:Helicase; superfamily 1/2; ATP-binding domain;IPR014014:RNA helicase; DEAD-box type; Q motif;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003501-RA | CNU23_00003501 | genemark-COCO01-processed-gene-57.59-mRNA-1 | XP_010942408 | E3 ubiquitin-protein ligase SP1(LOC105060424) | Elaeis guineensis | organelle organization [GO:0006996]; protein ubiquitination [GO:0016567] | membrane [GO:0016020] | metal ion binding [GO:0046872]; ubiquitin-protein transferase activity [GO:0004842] | - | IPR001841:Zinc finger; RING-type;IPR013083:Zinc finger; RING/FYVE/PHD-type;IPR022170:E3 Ubiquitin ligase; |
| CNU23_00003502-RA | CNU23_00003502 | maker-COCO01-augustus-gene-57.8-mRNA-1 | XP_029117889 | uncharacterized LOC114913355(LOC114913355) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003503-RA | CNU23_00003503 | maker-COCO01-augustus-gene-57.5-mRNA-1 | XP_029116373 | serine/threonine-protein kinase Nek5(LOC105060423) | Elaeis guineensis | protein phosphorylation [GO:0006468] | - | ATP binding [GO:0005524]; protein kinase activity [GO:0004672] | - | - |
| CNU23_00003504-RA | CNU23_00003504 | maker-COCO01-augustus-gene-57.6-mRNA-1 | XP_010942405 | exocyst complex component EXO70A1(LOC105060422) | Elaeis guineensis | exocytosis [GO:0006887]; protein transport [GO:0015031] | exocyst [GO:0000145] | phosphatidylinositol-4;5-bisphosphate binding [GO:0005546] | - | IPR004140:Exocyst complex protein Exo70;IPR016159:Cullin repeat-like-containing domain; |
| CNU23_00003505-RA | CNU23_00003505 | maker-COCO01-augustus-gene-58.0-mRNA-1 | XP_010942404 | NDR1/HIN1-like protein 12(LOC105060421) | Elaeis guineensis | defense response to other organism [GO:0098542] | membrane [GO:0016020] | - | - | IPR004864:Late embryogenesis abundant protein; LEA-14; |
| CNU23_00003506-RA | CNU23_00003506 | maker-COCO01-augustus-gene-58.22-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003507-RA | CNU23_00003507 | maker-COCO01-augustus-gene-58.7-mRNA-1 | XP_038976825 | Uncharacterized protein LOC120107566 | Phoenix dactylifera (Date palm) | - | - | - | - | - |
| CNU23_00003508-RA | CNU23_00003508 | maker-COCO01-augustus-gene-58.8-mRNA-1 | XP_010942403 | NDR1/HIN1-like protein 10(LOC105060420) | Elaeis guineensis | defense response to other organism [GO:0098542] | membrane [GO:0016020] | - | - | IPR004864:Late embryogenesis abundant protein; LEA-14; |
| CNU23_00003509-RA | CNU23_00003509 | maker-COCO01-augustus-gene-58.25-mRNA-1 | XP_010926881 | transcription termination factor MTEF1; chloroplastic(LOC105049043) | Elaeis guineensis | DNA-templated transcription termination [GO:0006353]; regulation of DNA-templated transcription [GO:0006355] | - | double-stranded DNA binding [GO:0003690] | - | IPR003690:Mitochodrial transcription termination factor-related; |
| CNU23_00003510-RA | CNU23_00003510 | maker-COCO01-augustus-gene-58.16-mRNA-1 | XP_019708847 | Uncharacterized protein LOC109506353 | Elaeis guineensis var. tenera (Oil palm) | - | - | - | - | - |
| CNU23_00003511-RA | CNU23_00003511 | maker-COCO01-augustus-gene-60.107-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003512-RA | CNU23_00003512 | genemark-COCO01-processed-gene-60.78-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003513-RA | CNU23_00003513 | maker-COCO01-augustus-gene-61.122-mRNA-1 | XP_010943800 | IAA-amino acid hydrolase ILR1-like 3(LOC105061452) | Elaeis guineensis | auxin metabolic process [GO:0009850] | - | hydrolase activity [GO:0016787] | - | IPR002933:Peptidase M20;IPR011650:Peptidase M20; dimerisation domain;IPR017439:Amidohydrolase; |
| CNU23_00003514-RA | CNU23_00003514 | maker-COCO01-augustus-gene-61.123-mRNA-1 | XP_010924947 | IAA-amino acid hydrolase ILR1-like 1(LOC105047633) | Elaeis guineensis | auxin metabolic process [GO:0009850] | - | hydrolase activity [GO:0016787] | - | IPR002933:Peptidase M20;IPR011650:Peptidase M20; dimerisation domain;IPR017439:Amidohydrolase; |
| CNU23_00003515-RA | CNU23_00003515 | maker-COCO01-augustus-gene-61.125-mRNA-1 | XP_010943803 | mRNA-decapping enzyme-like protein(LOC105061455) | Elaeis guineensis | deadenylation-dependent decapping of nuclear-transcribed mRNA [GO:0000290]; positive regulation of catalytic activity [GO:0043085] | intracellular organelle [GO:0043229] | enzyme activator activity [GO:0008047] | egu03018:RNA degradation; | IPR010334:Dcp1-like decapping;IPR011993:Pleckstrin homology-like domain; |
| CNU23_00003516-RA | CNU23_00003516 | genemark-COCO01-processed-gene-61.69-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003517-RA | CNU23_00003517 | maker-COCO01-augustus-gene-61.124-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003518-RA | CNU23_00003518 | maker-COCO01-augustus-gene-61.56-mRNA-1 | XP_038976548 | uncharacterized LOC120107363(LOC120107363) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003519-RA | CNU23_00003519 | maker-COCO01-augustus-gene-61.127-mRNA-1 | XP_010943811 | probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY(LOC105061459) | Elaeis guineensis | gibberellic acid mediated signaling pathway [GO:0009740]; protein glycosylation [GO:0006486] | nucleus [GO:0005634] | protein O-acetylglucosaminyltransferase activity [GO:0097363] | egu00514:Other types of O-glycan biosynthesis; | IPR001440:Tetratricopeptide TPR-1;IPR006597:Sel1-like;IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003520-RA | CNU23_00003520 | genemark-COCO01-processed-gene-61.111-mRNA-1 | XP_010943811 | probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY(LOC105061459) | Elaeis guineensis | gibberellic acid mediated signaling pathway [GO:0009740]; protein glycosylation [GO:0006486] | nucleus [GO:0005634] | protein O-acetylglucosaminyltransferase activity [GO:0097363] | egu00514:Other types of O-glycan biosynthesis; | IPR001440:Tetratricopeptide TPR-1;IPR006597:Sel1-like;IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003521-RA | CNU23_00003521 | genemark-COCO01-processed-gene-61.112-mRNA-1 | XP_010943786 | probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY(LOC105061442) | Elaeis guineensis | gibberellic acid mediated signaling pathway [GO:0009740]; protein glycosylation [GO:0006486] | nucleus [GO:0005634] | protein O-acetylglucosaminyltransferase activity [GO:0097363] | egu00514:Other types of O-glycan biosynthesis; | IPR001440:Tetratricopeptide TPR-1;IPR006597:Sel1-like;IPR011990:Tetratricopeptide-like helical;IPR019734:Tetratricopeptide repeat; |
| CNU23_00003522-RA | CNU23_00003522 | maker-COCO01-augustus-gene-62.5-mRNA-1 | XP_038971146 | uncharacterized LOC120104296(LOC120104296) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003523-RA | CNU23_00003523 | maker-COCO01-augustus-gene-62.1-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003524-RA | CNU23_00003524 | augustus-COCO01-processed-gene-62.117-mRNA-1 | XP_038973463 | uncharacterized LOC120105243(LOC120105243) | Phoenix dactylifera | - | - | - | - | - |
| CNU23_00003525-RA | CNU23_00003525 | maker-COCO01-augustus-gene-62.2-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003526-RA | CNU23_00003526 | genemark-COCO01-processed-gene-62.76-mRNA-1 | XP_010943816 | NAC domain-containing protein 90(LOC105061462) | Elaeis guineensis | regulation of DNA-templated transcription [GO:0006355] | - | DNA binding [GO:0003677] | - | IPR003441:No apical meristem (NAM) protein; |
| CNU23_00003527-RA | CNU23_00003527 | maker-COCO01-augustus-gene-62.47-mRNA-1 | XP_010943817 | uncharacterized LOC105061463(LOC105061463) | Elaeis guineensis | leaf senescence [GO:0010150] | - | - | - | IPR007608:Senescence regulator; |
| CNU23_00003528-RA | CNU23_00003528 | maker-COCO01-augustus-gene-62.0-mRNA-1 | XP_010943818 | sorting nexin 1(LOC105061464) | Elaeis guineensis | - | endosome [GO:0005768]; membrane [GO:0016020] | phosphatidylinositol binding [GO:0035091] | egu04144:Endocytosis; | IPR001683:Phox homologous domain;IPR015404:Vps5 C-terminal;IPR027267:Arfaptin homology (AH) domain/BAR domain; |
| CNU23_00003529-RA | CNU23_00003529 | genemark-COCO01-processed-gene-63.5-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003530-RA | CNU23_00003530 | maker-COCO01-augustus-gene-63.3-mRNA-1 | XP_010920785 | kinesin-like protein KIN-5B(LOC105044553) | Elaeis guineensis | microtubule-based movement [GO:0007018] | spindle [GO:0005819] | ATP binding [GO:0005524]; microtubule binding [GO:0008017]; microtubule motor activity [GO:0003777] | egu04814:Motor proteins; | IPR001752:Kinesin; motor domain;IPR019821:Kinesin; motor region; conserved site;IPR027417:P-loop containing nucleoside triphosphate hydrolase; |
| CNU23_00003531-RA | CNU23_00003531 | genemark-COCO01-processed-gene-63.41-mRNA-1 | XP_010943826 | uncharacterized LOC105061470(LOC105061470) | Elaeis guineensis | - | - | - | - | IPR010828:Alcohol acetyltransferase;IPR023213:Chloramphenicol acetyltransferase-like domain; |
| CNU23_00003532-RA | CNU23_00003532 | maker-COCO01-augustus-gene-63.21-mRNA-1 | XP_010907369 | amino acid transporter AVT3B(LOC105034046) | Elaeis guineensis | amino acid transport [GO:0006865] | membrane [GO:0016020] | - | - | IPR013057:Amino acid transporter; transmembrane; |
| CNU23_00003533-RA | CNU23_00003533 | genemark-COCO01-processed-gene-63.57-mRNA-1 | XP_010943826 | uncharacterized LOC105061470(LOC105061470) | Elaeis guineensis | - | - | - | - | IPR010828:Alcohol acetyltransferase;IPR023213:Chloramphenicol acetyltransferase-like domain; |
| CNU23_00003534-RA | CNU23_00003534 | maker-COCO01-augustus-gene-63.4-mRNA-1 | XP_029116640 | uncharacterized LOC105061472(LOC105061472) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003535-RA | CNU23_00003535 | maker-COCO01-augustus-gene-64.1-mRNA-1 | XP_010927807 | phytolongin Phyl1.1(LOC105049763) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR011012:Longin-like domain; |
| CNU23_00003536-RA | CNU23_00003536 | maker-COCO01-augustus-gene-65.144-mRNA-1 | XP_010926879 | uncharacterized LOC105049041(LOC105049041) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003537-RA | CNU23_00003537 | maker-COCO01-augustus-gene-65.146-mRNA-1 | XP_010926877 | uncharacterized protein At2g27730; mitochondrial(LOC105049040) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003538-RA | CNU23_00003538 | genemark-COCO01-processed-gene-65.108-mRNA-1 | XP_010926875 | uncharacterized protein At2g27730; mitochondrial(LOC105049039) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003539-RA | CNU23_00003539 | maker-COCO01-augustus-gene-65.23-mRNA-1 | XP_010919064 | protein MOS2(LOC105043277) | Elaeis guineensis | mRNA splicing; via spliceosome [GO:0000398] | nucleus [GO:0005634] | nucleic acid binding [GO:0003676] | - | IPR000467:G-patch domain;IPR005824:KOW;IPR026822:Protein MOS2; |
| CNU23_00003540-RA | CNU23_00003540 | genemark-COCO01-processed-gene-65.117-mRNA-1 | XP_010919062 | probable cinnamyl alcohol dehydrogenase 1(LOC105043276) | Elaeis guineensis | lignin biosynthetic process [GO:0009809] | - | oxidoreductase activity; acting on the CH-OH group of donors; NAD or NADP as acceptor [GO:0016616]; zinc ion binding [GO:0008270] | egu00940:Phenylpropanoid biosynthesis;egu01100:Metabolic pathways;egu01110:Biosynthesis of secondary metabolites; | IPR002328:Alcohol dehydrogenase; zinc-type; conserved site;IPR011032:GroES-like;IPR013149:Alcohol dehydrogenase; C-terminal;IPR013154:Alcohol dehydrogenase GroES-like;IPR020843:Polyketide synthase; enoylreductase; |
| CNU23_00003541-RA | CNU23_00003541 | maker-COCO01-augustus-gene-65.69-mRNA-1 | XP_010919060 | uncharacterized LOC105043275(LOC105043275) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003542-RA | CNU23_00003542 | maker-COCO01-augustus-gene-65.1-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003543-RA | CNU23_00003543 | maker-COCO01-augustus-gene-65.71-mRNA-1 | XP_010906743 | uncharacterized LOC105033578(LOC105033578) | Elaeis guineensis | - | - | - | - | IPR005162:Retrotransposon gag protein; |
| CNU23_00003544-RA | CNU23_00003544 | genemark-COCO01-processed-gene-65.79-mRNA-1 | XP_010919059 | neuromodulin(LOC105043274) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003545-RA | CNU23_00003545 | genemark-COCO01-processed-gene-65.120-mRNA-1 | XP_010919058 | uncharacterized protein C594.04c(LOC105043273) | Elaeis guineensis | lipid metabolic process [GO:0006629] | membrane [GO:0016020] | oxidoreductase activity; acting on the CH-CH group of donors [GO:0016627] | - | IPR001104:3-oxo-5-alpha-steroid 4-dehydrogenase; C-terminal;IPR010721:Protein of unknown function DUF1295; |
| CNU23_00003546-RA | CNU23_00003546 | maker-COCO01-augustus-gene-65.150-mRNA-1 | XP_010919057 | uncharacterized LOC105043272(LOC105043272) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003547-RA | CNU23_00003547 | maker-COCO01-augustus-gene-65.151-mRNA-1 | XP_010919056 | UNC93-like protein 1(LOC105043271) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR010291:Ion channel regulatory protein; UNC-93; |
| CNU23_00003548-RA | CNU23_00003548 | maker-COCO01-augustus-gene-65.39-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003549-RA | CNU23_00003549 | maker-COCO01-augustus-gene-66.2-mRNA-1 | XP_010906968 | uncharacterized LOC105033756(LOC105033756) | Elaeis guineensis | - | membrane [GO:0016020] | - | - | IPR004045:Glutathione S-transferase; N-terminal;IPR011767:Glutaredoxin active site; |
| CNU23_00003550-RA | CNU23_00003550 | genemark-COCO01-processed-gene-66.72-mRNA-1 | XP_010906963 | probable calcium-binding protein CML48(LOC105033753) | Elaeis guineensis | - | - | calcium ion binding [GO:0005509] | egu04626:Plant-pathogen interaction; | IPR002048:EF-hand domain;IPR011992:EF-hand-like domain;IPR018247:EF-Hand 1; calcium-binding site; |
| CNU23_00003551-RA | CNU23_00003551 | augustus-COCO01-processed-gene-66.40-mRNA-1 | XP_010905991 | uncharacterized LOC105033043(LOC105033043) | Elaeis guineensis | Golgi vesicle transport [GO:0048193]; protein transport [GO:0015031] | membrane [GO:0016020] | - | - | IPR010989:t-SNARE;IPR015260:Syntaxin 6; N-terminal; |
| CNU23_000003552-RA | CNU23_000003552 | maker-COCO01-augustus-gene-67.1-mRNA-1 | XP_038988323 | Uncharacterized protein LOC120112720 | Phoenix dactylifera (Date palm) | DNA integration [GO:0015074] | - | nucleic acid binding [GO:0003676] | - | IPR043502;IPR025724;IPR001584;IPR012337;IPR036397;IPR013103; |
| CNU23_00003552-RA | CNU23_00003552 | maker-COCO01-augustus-gene-67.1-mRNA-1 | XP_010905990 | Uncharacterized protein LOC105033042 | Elaeis guineensis var. tenera (Oil palm) | - | membrane [GO:0016020] | - | - | - |
| CNU23_00003553-RA | CNU23_00003553 | maker-COCO01-augustus-gene-67.3-mRNA-1 | XP_038973212 | uncharacterized LOC120105121(LOC120105121) | Phoenix dactylifera | DNA integration [GO:0015074] | - | nucleic acid binding [GO:0003676] | - | - |
| CNU23_00003554-RA | CNU23_00003554 | genemark-COCO01-processed-gene-67.61-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003555-RA | CNU23_00003555 | maker-COCO01-augustus-gene-67.30-mRNA-1 | XP_010905987 | 60S ribosomal protein L10a(LOC105033041) | Elaeis guineensis | translation [GO:0006412] | large ribosomal subunit [GO:0015934] | RNA binding [GO:0003723]; structural constituent of ribosome [GO:0003735] | egu03010:Ribosome; | IPR002143:Ribosomal protein L1;IPR016095:Ribosomal protein L1; 3-layer alpha/beta-sandwich;IPR023673:Ribosomal protein L1; conserved site;IPR023674:Ribosomal protein L1; superfamily; |
| CNU23_00003556-RA | CNU23_00003556 | maker-COCO01-augustus-gene-67.2-mRNA-1 | XP_019702069 | cytochrome b-c1 complex subunit 9(LOC109504955) | Elaeis guineensis | mitochondrial electron transport; ubiquinol to cytochrome c [GO:0006122] | mitochondrial respiratory chain complex III [GO:0005750] | - | egu00190:Oxidative phosphorylation;egu01100:Metabolic pathways; | IPR008027:Cytochrome b-c1 complex subunit 9; |
| CNU23_00003557-RA | CNU23_00003557 | maker-COCO01-augustus-gene-68.3-mRNA-1 | XP_019702069 | cytochrome b-c1 complex subunit 9(LOC109504955) | Elaeis guineensis | mitochondrial electron transport; ubiquinol to cytochrome c [GO:0006122] | mitochondrial respiratory chain complex III [GO:0005750] | - | egu00190:Oxidative phosphorylation;egu01100:Metabolic pathways; | IPR008027:Cytochrome b-c1 complex subunit 9; |
| CNU23_00003558-RA | CNU23_00003558 | maker-COCO01-augustus-gene-68.4-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003559-RA | CNU23_00003559 | maker-COCO01-augustus-gene-68.0-mRNA-1 | XP_010921576 | Coatomer subunit beta' | Elaeis guineensis var. tenera (Oil palm) | intracellular protein transport [GO:0006886]; vesicle-mediated transport [GO:0016192] | COPI-coated vesicle membrane [GO:0030663]; Golgi membrane [GO:0000139]; membrane coat [GO:0030117] | structural molecule activity [GO:0005198] | - | IPR006692;IPR016453;IPR020472;IPR015943;IPR001680;IPR036322; |
| CNU23_00003560-RA | CNU23_00003560 | maker-COCO01-augustus-gene-68.66-mRNA-1 | XP_029117471 | protein BIC1-like(LOC114913073) | Elaeis guineensis | - | - | - | - | - |
| CNU23_00003561-RA | CNU23_00003561 | maker-COCO01-augustus-gene-68.5-mRNA-1 | XP_010905974 | cell division protein FtsZ homolog 2-1; chloroplastic(LOC105033038) | Elaeis guineensis | cell division [GO:0051301] | - | GTP binding [GO:0005525]; GTPase activity [GO:0003924] | - | IPR000158:Cell division protein FtsZ;IPR003008:Tubulin/FtsZ; GTPase domain;IPR008280:Tubulin/FtsZ; C-terminal;IPR018316:Tubulin/FtsZ; 2-layer sandwich domain;IPR020805:Cell division protein FtsZ; conserved site;IPR024757:Cell division protein FtsZ; C-terminal; |
| CNU23_00003562-RA | CNU23_00003562 | maker-COCO01-augustus-gene-68.19-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003563-RA | CNU23_00003563 | genemark-COCO01-processed-gene-68.44-mRNA-1 | - | - | - | - | - | - | 0 | - |
| CNU23_00003564-RA | CNU23_00003564 | maker-COCO01-augustus-gene-68.6-mRNA-1 | XP_019702475 | uncharacterized protein YnbD(LOC105034228) | Elaeis guineensis | protein dephosphorylation [GO:0006470] | membrane [GO:0016020] | protein tyrosine/serine/threonine phosphatase activity [GO:0008138] | - | IPR000340:Dual specificity phosphatase; catalytic domain;IPR000387:Protein-tyrosine/Dual specificity phosphatase;IPR020422:Dual specificity phosphatase; subgroup; catalytic domain; |
| CNU23_00003565-RA | CNU23_00003565 | maker-COCO01-augustus-gene-68.2-mRNA-1 | XP_010907585 | ACT domain-containing protein ACR12(LOC105034226) | Elaeis guineensis | - | - | amino acid binding [GO:0016597] | - | - |
| CNU23_00003566-RA | CNU23_00003566 | maker-COCO01-augustus-gene-68.7-mRNA-1 | XP_010907998 | protein ABSCISIC ACID-INSENSITIVE 5-like(LOC105034504) | Elaeis guineensis | abscisic acid-activated signaling pathway [GO:0009738]; positive regulation of DNA-templated transcription [GO:0045893] | nucleus [GO:0005634] | DNA-binding transcription factor activity [GO:0003700] | egu04075:Plant hormone signal transduction; | IPR004827:Basic-leucine zipper domain; |
| CNU23_00003567-RA | CNU23_00003567 | maker-COCO01-augustus-gene-69.100-mRNA-1 | XP_010907585 | ACT domain-containing protein ACR12(LOC105034226) | Elaeis guineensis | - | - | amino acid binding [GO:0016597] | - | - |
| CNU23_00003568-RA | CNU23_00003568 | maker-COCO01-augustus-gene-69.101-mRNA-1 | XP_010907998 | protein ABSCISIC ACID-INSENSITIVE 5-like(LOC105034504) | Elaeis guineensis | abscisic acid-activated signaling pathway [GO:0009738]; positive regulation of DNA-templated transcription [GO:0045893] | nucleus [GO:0005634] | DNA-binding transcription factor activity [GO:0003700] | egu04075:Plant hormone signal transduction; | IPR004827:Basic-leucine zipper domain; |